C27H43NO4 — CID 176661180
(2E,4E,6E,8E)-N-[5-(hydroperoxymethyl)-6-hydroxyhexyl]-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenamide (PubChem CID 176661180) has the molecular formula C27H43NO4 and a molecular weight of 445.64 g/mol. Its IUPAC name is (2E,4E,6E,8E)-N-[5-(hydroperoxymethyl)-6-hydroxyhexyl]-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenamide.
| Compound Name | (2E,4E,6E,8E)-N-[5-(hydroperoxymethyl)-6-hydroxyhexyl]-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenamide |
|---|---|
| PubChem CID | 176661180 |
| Molecular Formula | C27H43NO4 |
| Molecular Weight | 445.64 g/mol |
| Exact Mass | 445.32 |
| IUPAC Name | (2E,4E,6E,8E)-N-[5-(hydroperoxymethyl)-6-hydroxyhexyl]-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenamide |
| SMILES | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/C(=O)NCCCCC(CO)COO)C(C)(C)CCC1 |
| InChI | InChI=1S/C27H43NO4/c1-21(14-15-25-23(3)12-9-16-27(25,4)5)10-8-11-22(2)18-26(30)28-17-7-6-13-24(19-29)20-32-31/h8,10-11,14-15,18,24,29,31H,6-7,9,12-13,16-17,19-20H2,1-5H3,(H,28,30)/b11-8+,15-14+,21-10+,22-18+ |
| InChIKey | FZTXVEOSSNXCCE-XTPGQYRFSA-N |
| XLogP | 5.90 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.64 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|