C18H18N6O — CID 176661410
5-(2-ethoxyethyl)-1-[3-(1H-1,2,4-triazol-5-yl)phenyl]pyrazolo[5,4-b]pyridine (PubChem CID 176661410) has the molecular formula C18H18N6O and a molecular weight of 334.38 g/mol. Its IUPAC name is 5-(2-ethoxyethyl)-1-[3-(1H-1,2,4-triazol-5-yl)phenyl]pyrazolo[5,4-b]pyridine.
| Compound Name | 5-(2-ethoxyethyl)-1-[3-(1H-1,2,4-triazol-5-yl)phenyl]pyrazolo[5,4-b]pyridine |
|---|---|
| PubChem CID | 176661410 |
| Molecular Formula | C18H18N6O |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | 5-(2-ethoxyethyl)-1-[3-(1H-1,2,4-triazol-5-yl)phenyl]pyrazolo[5,4-b]pyridine |
| SMILES | CCOCCc1cnc2c(cnn2-c2cccc(-c3ncn[nH]3)c2)c1 |
| InChI | InChI=1S/C18H18N6O/c1-2-25-7-6-13-8-15-11-22-24(18(15)19-10-13)16-5-3-4-14(9-16)17-20-12-21-23-17/h3-5,8-12H,2,6-7H2,1H3,(H,20,21,23) |
| InChIKey | ZQSPHKZZMFBUGQ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 81.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|