About acetaldehyde;hexane;3-(5-methylbenzimidazol-1-yl)phenol
acetaldehyde;hexane;3-(5-methylbenzimidazol-1-yl)phenol (PubChem CID 176661516) has the molecular formula C22H30N2O2
and a molecular weight of 354.49 g/mol. Its IUPAC name is acetaldehyde;hexane;3-(5-methylbenzimidazol-1-yl)phenol.
Molecular Properties
| Compound Name | acetaldehyde;hexane;3-(5-methylbenzimidazol-1-yl)phenol |
| PubChem CID | 176661516 |
| Molecular Formula | C22H30N2O2 |
| Molecular Weight | 354.49 g/mol |
| Exact Mass | 354.23 |
| IUPAC Name | acetaldehyde;hexane;3-(5-methylbenzimidazol-1-yl)phenol |
| SMILES | CC=O.CCCCCC.Cc1ccc2c(c1)ncn2-c1cccc(O)c1 |
| InChI | InChI=1S/C14H12N2O.C6H14.C2H4O/c1-10-5-6-14-13(7-10)15-9-16(14)11-3-2-4-12(17)8-11;1-3-5-6-4-2;1-2-3/h2-9,17H,1H3;3-6H2,1-2H3;2H,1H3 |
| InChIKey | KXFORDBNPWEPNW-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 354.49 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze acetaldehyde;hexane;3-(5-methylbenzimidazol-1-yl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetaldehyde;hexane;3-(5-methylbenzimidazol-1-yl)phenol?
The IUPAC name of acetaldehyde;hexane;3-(5-methylbenzimidazol-1-yl)phenol (CID 176661516) is acetaldehyde;hexane;3-(5-methylbenzimidazol-1-yl)phenol.
What is the SMILES notation for acetaldehyde;hexane;3-(5-methylbenzimidazol-1-yl)phenol?
The canonical SMILES for acetaldehyde;hexane;3-(5-methylbenzimidazol-1-yl)phenol is CC=O.CCCCCC.Cc1ccc2c(c1)ncn2-c1cccc(O)c1.
What is the InChIKey of acetaldehyde;hexane;3-(5-methylbenzimidazol-1-yl)phenol?
The InChIKey is KXFORDBNPWEPNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12N2O.C6H14.C2H4O/c1-10-5-6-14-13(7-10)15-9-16(14)11-3-2-4-12(17)8-11;1-3-5-6-4-2;1-2-3/h2-9,17H,1H3;3-6H2,1-2H3;2H,1H3.
What are the key properties of acetaldehyde;hexane;3-(5-methylbenzimidazol-1-yl)phenol?
acetaldehyde;hexane;3-(5-methylbenzimidazol-1-yl)phenol has a molecular weight of 354.49 g/mol, XLogP of 5.83, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for acetaldehyde;hexane;3-(5-methylbenzimidazol-1-yl)phenol is sourced from PubChem (CID 176661516), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).