About 5-ethenyl-1-(4-methylphenyl)pyrrolo[2,3-b]pyridine;1-methylpyrrolidine
5-ethenyl-1-(4-methylphenyl)pyrrolo[2,3-b]pyridine;1-methylpyrrolidine (PubChem CID 176661519) has the molecular formula C21H25N3
and a molecular weight of 319.45 g/mol. Its IUPAC name is 5-ethenyl-1-(4-methylphenyl)pyrrolo[2,3-b]pyridine;1-methylpyrrolidine.
Molecular Properties
| Compound Name | 5-ethenyl-1-(4-methylphenyl)pyrrolo[2,3-b]pyridine;1-methylpyrrolidine |
| PubChem CID | 176661519 |
| Molecular Formula | C21H25N3 |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.20 |
| IUPAC Name | 5-ethenyl-1-(4-methylphenyl)pyrrolo[2,3-b]pyridine;1-methylpyrrolidine |
| SMILES | C=Cc1cnc2c(ccn2-c2ccc(C)cc2)c1.CN1CCCC1 |
| InChI | InChI=1S/C16H14N2.C5H11N/c1-3-13-10-14-8-9-18(16(14)17-11-13)15-6-4-12(2)5-7-15;1-6-4-2-3-5-6/h3-11H,1H2,2H3;2-5H2,1H3 |
| InChIKey | QEFRHFYOBGNHSU-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-ethenyl-1-(4-methylphenyl)pyrrolo[2,3-b]pyridine;1-methylpyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethenyl-1-(4-methylphenyl)pyrrolo[2,3-b]pyridine;1-methylpyrrolidine?
The IUPAC name of 5-ethenyl-1-(4-methylphenyl)pyrrolo[2,3-b]pyridine;1-methylpyrrolidine (CID 176661519) is 5-ethenyl-1-(4-methylphenyl)pyrrolo[2,3-b]pyridine;1-methylpyrrolidine.
What is the SMILES notation for 5-ethenyl-1-(4-methylphenyl)pyrrolo[2,3-b]pyridine;1-methylpyrrolidine?
The canonical SMILES for 5-ethenyl-1-(4-methylphenyl)pyrrolo[2,3-b]pyridine;1-methylpyrrolidine is C=Cc1cnc2c(ccn2-c2ccc(C)cc2)c1.CN1CCCC1.
What is the InChIKey of 5-ethenyl-1-(4-methylphenyl)pyrrolo[2,3-b]pyridine;1-methylpyrrolidine?
The InChIKey is QEFRHFYOBGNHSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14N2.C5H11N/c1-3-13-10-14-8-9-18(16(14)17-11-13)15-6-4-12(2)5-7-15;1-6-4-2-3-5-6/h3-11H,1H2,2H3;2-5H2,1H3.
What are the key properties of 5-ethenyl-1-(4-methylphenyl)pyrrolo[2,3-b]pyridine;1-methylpyrrolidine?
5-ethenyl-1-(4-methylphenyl)pyrrolo[2,3-b]pyridine;1-methylpyrrolidine has a molecular weight of 319.45 g/mol, XLogP of 4.69, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethenyl-1-(4-methylphenyl)pyrrolo[2,3-b]pyridine;1-methylpyrrolidine is sourced from PubChem (CID 176661519), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).