C11H17Cl — CID 176661834
(3Z)-2-chloro-7,7-dimethyl-5-methylideneocta-1,3-diene (PubChem CID 176661834) has the molecular formula C11H17Cl and a molecular weight of 184.71 g/mol. Its IUPAC name is (3Z)-2-chloro-7,7-dimethyl-5-methylideneocta-1,3-diene.
| Compound Name | (3Z)-2-chloro-7,7-dimethyl-5-methylideneocta-1,3-diene |
|---|---|
| PubChem CID | 176661834 |
| Molecular Formula | C11H17Cl |
| Molecular Weight | 184.71 g/mol |
| Exact Mass | 184.10 |
| IUPAC Name | (3Z)-2-chloro-7,7-dimethyl-5-methylideneocta-1,3-diene |
| SMILES | C=C(Cl)/C=C\C(=C)CC(C)(C)C |
| InChI | InChI=1S/C11H17Cl/c1-9(6-7-10(2)12)8-11(3,4)5/h6-7H,1-2,8H2,3-5H3/b7-6- |
| InChIKey | KTEZRQHUMXUUDR-SREVYHEPSA-N |
| XLogP | 4.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.71 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|