About 3-ethyloxetane;3-(2-methylpropyl)pyridin-2-amine
3-ethyloxetane;3-(2-methylpropyl)pyridin-2-amine (PubChem CID 176663993) has the molecular formula C14H24N2O
and a molecular weight of 236.36 g/mol. Its IUPAC name is 3-ethyloxetane;3-(2-methylpropyl)pyridin-2-amine.
Molecular Properties
| Compound Name | 3-ethyloxetane;3-(2-methylpropyl)pyridin-2-amine |
| PubChem CID | 176663993 |
| Molecular Formula | C14H24N2O |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.19 |
| IUPAC Name | 3-ethyloxetane;3-(2-methylpropyl)pyridin-2-amine |
| SMILES | CC(C)Cc1cccnc1N.CCC1COC1 |
| InChI | InChI=1S/C9H14N2.C5H10O/c1-7(2)6-8-4-3-5-11-9(8)10;1-2-5-3-6-4-5/h3-5,7H,6H2,1-2H3,(H2,10,11);5H,2-4H2,1H3 |
| InChIKey | PQLLITXYSTUEPN-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-ethyloxetane;3-(2-methylpropyl)pyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyloxetane;3-(2-methylpropyl)pyridin-2-amine?
The IUPAC name of 3-ethyloxetane;3-(2-methylpropyl)pyridin-2-amine (CID 176663993) is 3-ethyloxetane;3-(2-methylpropyl)pyridin-2-amine.
What is the SMILES notation for 3-ethyloxetane;3-(2-methylpropyl)pyridin-2-amine?
The canonical SMILES for 3-ethyloxetane;3-(2-methylpropyl)pyridin-2-amine is CC(C)Cc1cccnc1N.CCC1COC1.
What is the InChIKey of 3-ethyloxetane;3-(2-methylpropyl)pyridin-2-amine?
The InChIKey is PQLLITXYSTUEPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2.C5H10O/c1-7(2)6-8-4-3-5-11-9(8)10;1-2-5-3-6-4-5/h3-5,7H,6H2,1-2H3,(H2,10,11);5H,2-4H2,1H3.
What are the key properties of 3-ethyloxetane;3-(2-methylpropyl)pyridin-2-amine?
3-ethyloxetane;3-(2-methylpropyl)pyridin-2-amine has a molecular weight of 236.36 g/mol, XLogP of 2.91, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyloxetane;3-(2-methylpropyl)pyridin-2-amine is sourced from PubChem (CID 176663993), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).