About 3-[(1E,2R)-1-methoxyimino-3-methylbutan-2-yl]pyridin-2-amine
3-[(1E,2R)-1-methoxyimino-3-methylbutan-2-yl]pyridin-2-amine (PubChem CID 176664499) has the molecular formula C11H17N3O
and a molecular weight of 207.28 g/mol. Its IUPAC name is 3-[(1E,2R)-1-methoxyimino-3-methylbutan-2-yl]pyridin-2-amine.
Molecular Properties
| Compound Name | 3-[(1E,2R)-1-methoxyimino-3-methylbutan-2-yl]pyridin-2-amine |
| PubChem CID | 176664499 |
| Molecular Formula | C11H17N3O |
| Molecular Weight | 207.28 g/mol |
| Exact Mass | 207.14 |
| IUPAC Name | 3-[(1E,2R)-1-methoxyimino-3-methylbutan-2-yl]pyridin-2-amine |
| SMILES | CO/N=C/[C@@H](c1cccnc1N)C(C)C |
| InChI | InChI=1S/C11H17N3O/c1-8(2)10(7-14-15-3)9-5-4-6-13-11(9)12/h4-8,10H,1-3H3,(H2,12,13)/b14-7+/t10-/m1/s1 |
| InChIKey | PYQBFLPHYIFECN-FBWGLTFQSA-N |
| XLogP | 2.04 |
| TPSA | 60.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.28 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-[(1E,2R)-1-methoxyimino-3-methylbutan-2-yl]pyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(1E,2R)-1-methoxyimino-3-methylbutan-2-yl]pyridin-2-amine?
The IUPAC name of 3-[(1E,2R)-1-methoxyimino-3-methylbutan-2-yl]pyridin-2-amine (CID 176664499) is 3-[(1E,2R)-1-methoxyimino-3-methylbutan-2-yl]pyridin-2-amine.
What is the SMILES notation for 3-[(1E,2R)-1-methoxyimino-3-methylbutan-2-yl]pyridin-2-amine?
The canonical SMILES for 3-[(1E,2R)-1-methoxyimino-3-methylbutan-2-yl]pyridin-2-amine is CO/N=C/[C@@H](c1cccnc1N)C(C)C.
What is the InChIKey of 3-[(1E,2R)-1-methoxyimino-3-methylbutan-2-yl]pyridin-2-amine?
The InChIKey is PYQBFLPHYIFECN-FBWGLTFQSA-N. The full InChI is InChI=1S/C11H17N3O/c1-8(2)10(7-14-15-3)9-5-4-6-13-11(9)12/h4-8,10H,1-3H3,(H2,12,13)/b14-7+/t10-/m1/s1.
What are the key properties of 3-[(1E,2R)-1-methoxyimino-3-methylbutan-2-yl]pyridin-2-amine?
3-[(1E,2R)-1-methoxyimino-3-methylbutan-2-yl]pyridin-2-amine has a molecular weight of 207.28 g/mol, XLogP of 2.04, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(1E,2R)-1-methoxyimino-3-methylbutan-2-yl]pyridin-2-amine is sourced from PubChem (CID 176664499), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).