C24H29FN4O3S — CID 176664750
5-(6-amino-1-cyclohexylindazole-3-carbonyl)-N-tert-butyl-2-fluorobenzenesulfonamide (PubChem CID 176664750) has the molecular formula C24H29FN4O3S and a molecular weight of 472.59 g/mol. Its IUPAC name is 5-(6-amino-1-cyclohexylindazole-3-carbonyl)-N-tert-butyl-2-fluorobenzenesulfonamide.
| Compound Name | 5-(6-amino-1-cyclohexylindazole-3-carbonyl)-N-tert-butyl-2-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 176664750 |
| Molecular Formula | C24H29FN4O3S |
| Molecular Weight | 472.59 g/mol |
| Exact Mass | 472.19 |
| IUPAC Name | 5-(6-amino-1-cyclohexylindazole-3-carbonyl)-N-tert-butyl-2-fluorobenzenesulfonamide |
| SMILES | CC(C)(C)NS(=O)(=O)c1cc(C(=O)c2nn(C3CCCCC3)c3cc(N)ccc23)ccc1F |
| InChI | InChI=1S/C24H29FN4O3S/c1-24(2,3)28-33(31,32)21-13-15(9-12-19(21)25)23(30)22-18-11-10-16(26)14-20(18)29(27-22)17-7-5-4-6-8-17/h9-14,17,28H,4-8,26H2,1-3H3 |
| InChIKey | OHZSSPMWKODLEN-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 107.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.59 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|