C23H27FN4O3S — CID 176664783
5-(6-amino-1-cyclopentylindazole-3-carbonyl)-N-tert-butyl-2-fluorobenzenesulfonamide (PubChem CID 176664783) has the molecular formula C23H27FN4O3S and a molecular weight of 458.56 g/mol. Its IUPAC name is 5-(6-amino-1-cyclopentylindazole-3-carbonyl)-N-tert-butyl-2-fluorobenzenesulfonamide.
| Compound Name | 5-(6-amino-1-cyclopentylindazole-3-carbonyl)-N-tert-butyl-2-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 176664783 |
| Molecular Formula | C23H27FN4O3S |
| Molecular Weight | 458.56 g/mol |
| Exact Mass | 458.18 |
| IUPAC Name | 5-(6-amino-1-cyclopentylindazole-3-carbonyl)-N-tert-butyl-2-fluorobenzenesulfonamide |
| SMILES | CC(C)(C)NS(=O)(=O)c1cc(C(=O)c2nn(C3CCCC3)c3cc(N)ccc23)ccc1F |
| InChI | InChI=1S/C23H27FN4O3S/c1-23(2,3)27-32(30,31)20-12-14(8-11-18(20)24)22(29)21-17-10-9-15(25)13-19(17)28(26-21)16-6-4-5-7-16/h8-13,16,27H,4-7,25H2,1-3H3 |
| InChIKey | VMWRYVPIMJCHMG-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 107.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.56 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|