C24H45NO2 — CID 176665102
butane;5-ethyl-2-(2,2,6,6-tetramethyloxan-4-yl)oxypyridine (PubChem CID 176665102) has the molecular formula C24H45NO2 and a molecular weight of 379.63 g/mol. Its IUPAC name is butane;5-ethyl-2-(2,2,6,6-tetramethyloxan-4-yl)oxypyridine.
| Compound Name | butane;5-ethyl-2-(2,2,6,6-tetramethyloxan-4-yl)oxypyridine |
|---|---|
| PubChem CID | 176665102 |
| Molecular Formula | C24H45NO2 |
| Molecular Weight | 379.63 g/mol |
| Exact Mass | 379.35 |
| IUPAC Name | butane;5-ethyl-2-(2,2,6,6-tetramethyloxan-4-yl)oxypyridine |
| SMILES | CCCC.CCCC.CCc1ccc(OC2CC(C)(C)OC(C)(C)C2)nc1 |
| InChI | InChI=1S/C16H25NO2.2C4H10/c1-6-12-7-8-14(17-11-12)18-13-9-15(2,3)19-16(4,5)10-13;2*1-3-4-2/h7-8,11,13H,6,9-10H2,1-5H3;2*3-4H2,1-2H3 |
| InChIKey | HJOZGFMMHMPJNW-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.63 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |