C18H33NO — CID 176665263
ethane;1-(2-methyl-5-propan-2-ylphenyl)pyrrolidin-3-ol (PubChem CID 176665263) has the molecular formula C18H33NO and a molecular weight of 279.47 g/mol. Its IUPAC name is ethane;1-(2-methyl-5-propan-2-ylphenyl)pyrrolidin-3-ol.
| Compound Name | ethane;1-(2-methyl-5-propan-2-ylphenyl)pyrrolidin-3-ol |
|---|---|
| PubChem CID | 176665263 |
| Molecular Formula | C18H33NO |
| Molecular Weight | 279.47 g/mol |
| Exact Mass | 279.26 |
| IUPAC Name | ethane;1-(2-methyl-5-propan-2-ylphenyl)pyrrolidin-3-ol |
| SMILES | CC.CC.Cc1ccc(C(C)C)cc1N1CCC(O)C1 |
| InChI | InChI=1S/C14H21NO.2C2H6/c1-10(2)12-5-4-11(3)14(8-12)15-7-6-13(16)9-15;2*1-2/h4-5,8,10,13,16H,6-7,9H2,1-3H3;2*1-2H3 |
| InChIKey | UIVCNMGKFDMQIT-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.47 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |