C20H31NO2 — CID 176665322
4-(4-benzyl-6-methylmorpholin-2-yl)butan-1-ol;buta-1,3-diene (PubChem CID 176665322) has the molecular formula C20H31NO2 and a molecular weight of 317.47 g/mol. Its IUPAC name is 4-(4-benzyl-6-methylmorpholin-2-yl)butan-1-ol;buta-1,3-diene.
| Compound Name | 4-(4-benzyl-6-methylmorpholin-2-yl)butan-1-ol;buta-1,3-diene |
|---|---|
| PubChem CID | 176665322 |
| Molecular Formula | C20H31NO2 |
| Molecular Weight | 317.47 g/mol |
| Exact Mass | 317.24 |
| IUPAC Name | 4-(4-benzyl-6-methylmorpholin-2-yl)butan-1-ol;buta-1,3-diene |
| SMILES | C=CC=C.CC1CN(Cc2ccccc2)CC(CCCCO)O1 |
| InChI | InChI=1S/C16H25NO2.C4H6/c1-14-11-17(12-15-7-3-2-4-8-15)13-16(19-14)9-5-6-10-18;1-3-4-2/h2-4,7-8,14,16,18H,5-6,9-13H2,1H3;3-4H,1-2H2 |
| InChIKey | HQAVOKTYXSUNCS-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.47 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|