C24H21FN4O3S — CID 176665328
4-ethyl-N-[[2-(6-fluoro-2-pyridinyl)-1,6-naphthyridin-7-yl]methyl]-3-methylsulfonylbenzamide (PubChem CID 176665328) has the molecular formula C24H21FN4O3S and a molecular weight of 464.52 g/mol. Its IUPAC name is 4-ethyl-N-[[2-(6-fluoro-2-pyridinyl)-1,6-naphthyridin-7-yl]methyl]-3-methylsulfonylbenzamide.
| Compound Name | 4-ethyl-N-[[2-(6-fluoro-2-pyridinyl)-1,6-naphthyridin-7-yl]methyl]-3-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 176665328 |
| Molecular Formula | C24H21FN4O3S |
| Molecular Weight | 464.52 g/mol |
| Exact Mass | 464.13 |
| IUPAC Name | 4-ethyl-N-[[2-(6-fluoro-2-pyridinyl)-1,6-naphthyridin-7-yl]methyl]-3-methylsulfonylbenzamide |
| SMILES | CCc1ccc(C(=O)NCc2cc3nc(-c4cccc(F)n4)ccc3cn2)cc1S(C)(=O)=O |
| InChI | InChI=1S/C24H21FN4O3S/c1-3-15-7-8-16(11-22(15)33(2,31)32)24(30)27-14-18-12-21-17(13-26-18)9-10-20(28-21)19-5-4-6-23(25)29-19/h4-13H,3,14H2,1-2H3,(H,27,30) |
| InChIKey | SMHMRVDNNRREFA-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 101.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.52 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|