About 4-fluoro-1-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)butan-1-one
4-fluoro-1-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)butan-1-one (PubChem CID 176665691) has the molecular formula C10H16FNO
and a molecular weight of 185.24 g/mol. Its IUPAC name is 4-fluoro-1-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)butan-1-one.
Molecular Properties
| Compound Name | 4-fluoro-1-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)butan-1-one |
| PubChem CID | 176665691 |
| Molecular Formula | C10H16FNO |
| Molecular Weight | 185.24 g/mol |
| Exact Mass | 185.12 |
| IUPAC Name | 4-fluoro-1-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)butan-1-one |
| SMILES | CC1=CCN(C(=O)CCCF)CC1 |
| InChI | InChI=1S/C10H16FNO/c1-9-4-7-12(8-5-9)10(13)3-2-6-11/h4H,2-3,5-8H2,1H3 |
| InChIKey | MIPADZRRXPKLHF-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.24 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-fluoro-1-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)butan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluoro-1-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)butan-1-one?
The IUPAC name of 4-fluoro-1-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)butan-1-one (CID 176665691) is 4-fluoro-1-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)butan-1-one.
What is the SMILES notation for 4-fluoro-1-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)butan-1-one?
The canonical SMILES for 4-fluoro-1-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)butan-1-one is CC1=CCN(C(=O)CCCF)CC1.
What is the InChIKey of 4-fluoro-1-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)butan-1-one?
The InChIKey is MIPADZRRXPKLHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16FNO/c1-9-4-7-12(8-5-9)10(13)3-2-6-11/h4H,2-3,5-8H2,1H3.
What are the key properties of 4-fluoro-1-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)butan-1-one?
4-fluoro-1-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)butan-1-one has a molecular weight of 185.24 g/mol, XLogP of 1.91, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoro-1-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)butan-1-one is sourced from PubChem (CID 176665691), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).