C30H32BN5OS — CID 176665731
CID 176665731 (PubChem CID 176665731) has the molecular formula C30H32BN5OS and a molecular weight of 521.50 g/mol.
| Compound Name | CID 176665731 |
|---|---|
| PubChem CID | 176665731 |
| Molecular Formula | C30H32BN5OS |
| Molecular Weight | 521.50 g/mol |
| Exact Mass | 521.24 |
| IUPAC Name | — |
| SMILES | [B]C1C(C)CN(c2cccc(-c3ccc4cnc(CNC(=O)c5ccc(C)c(SC)c5)cc4n3)n2)CC1C |
| InChI | InChI=1S/C30H32BN5OS/c1-18-8-9-21(12-27(18)38-4)30(37)33-15-23-13-26-22(14-32-23)10-11-25(34-26)24-6-5-7-28(35-24)36-16-19(2)29(31)20(3)17-36/h5-14,19-20,29H,15-17H2,1-4H3,(H,33,37) |
| InChIKey | RXSZYQMIWQPPCG-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 71.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.50 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|