About 1-(oxan-4-ylsulfonyl)-2,3-dihydroindole-6-carboxamide
1-(oxan-4-ylsulfonyl)-2,3-dihydroindole-6-carboxamide (PubChem CID 176666413) has the molecular formula C14H18N2O4S
and a molecular weight of 310.38 g/mol. Its IUPAC name is 1-(oxan-4-ylsulfonyl)-2,3-dihydroindole-6-carboxamide.
Molecular Properties
| Compound Name | 1-(oxan-4-ylsulfonyl)-2,3-dihydroindole-6-carboxamide |
| PubChem CID | 176666413 |
| Molecular Formula | C14H18N2O4S |
| Molecular Weight | 310.38 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | 1-(oxan-4-ylsulfonyl)-2,3-dihydroindole-6-carboxamide |
| SMILES | NC(=O)c1ccc2c(c1)N(S(=O)(=O)C1CCOCC1)CC2 |
| InChI | InChI=1S/C14H18N2O4S/c15-14(17)11-2-1-10-3-6-16(13(10)9-11)21(18,19)12-4-7-20-8-5-12/h1-2,9,12H,3-8H2,(H2,15,17) |
| InChIKey | JTWJQVJNEPGAAO-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.38 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(oxan-4-ylsulfonyl)-2,3-dihydroindole-6-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(oxan-4-ylsulfonyl)-2,3-dihydroindole-6-carboxamide?
The IUPAC name of 1-(oxan-4-ylsulfonyl)-2,3-dihydroindole-6-carboxamide (CID 176666413) is 1-(oxan-4-ylsulfonyl)-2,3-dihydroindole-6-carboxamide.
What is the SMILES notation for 1-(oxan-4-ylsulfonyl)-2,3-dihydroindole-6-carboxamide?
The canonical SMILES for 1-(oxan-4-ylsulfonyl)-2,3-dihydroindole-6-carboxamide is NC(=O)c1ccc2c(c1)N(S(=O)(=O)C1CCOCC1)CC2.
What is the InChIKey of 1-(oxan-4-ylsulfonyl)-2,3-dihydroindole-6-carboxamide?
The InChIKey is JTWJQVJNEPGAAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18N2O4S/c15-14(17)11-2-1-10-3-6-16(13(10)9-11)21(18,19)12-4-7-20-8-5-12/h1-2,9,12H,3-8H2,(H2,15,17).
What are the key properties of 1-(oxan-4-ylsulfonyl)-2,3-dihydroindole-6-carboxamide?
1-(oxan-4-ylsulfonyl)-2,3-dihydroindole-6-carboxamide has a molecular weight of 310.38 g/mol, XLogP of 0.66, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(oxan-4-ylsulfonyl)-2,3-dihydroindole-6-carboxamide is sourced from PubChem (CID 176666413), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).