About 6-chloro-3-methyl-2-[(2R,6S)-2-methyl-6-(trifluoromethyl)morpholin-4-yl]pyrimidin-4-one
6-chloro-3-methyl-2-[(2R,6S)-2-methyl-6-(trifluoromethyl)morpholin-4-yl]pyrimidin-4-one (PubChem CID 176666613) has the molecular formula C11H13ClF3N3O2
and a molecular weight of 311.69 g/mol. Its IUPAC name is 6-chloro-3-methyl-2-[(2R,6S)-2-methyl-6-(trifluoromethyl)morpholin-4-yl]pyrimidin-4-one.
Molecular Properties
| Compound Name | 6-chloro-3-methyl-2-[(2R,6S)-2-methyl-6-(trifluoromethyl)morpholin-4-yl]pyrimidin-4-one |
| PubChem CID | 176666613 |
| Molecular Formula | C11H13ClF3N3O2 |
| Molecular Weight | 311.69 g/mol |
| Exact Mass | 311.06 |
| IUPAC Name | 6-chloro-3-methyl-2-[(2R,6S)-2-methyl-6-(trifluoromethyl)morpholin-4-yl]pyrimidin-4-one |
| SMILES | C[C@@H]1CN(c2nc(Cl)cc(=O)n2C)C[C@@H](C(F)(F)F)O1 |
| InChI | InChI=1S/C11H13ClF3N3O2/c1-6-4-18(5-7(20-6)11(13,14)15)10-16-8(12)3-9(19)17(10)2/h3,6-7H,4-5H2,1-2H3/t6-,7+/m1/s1 |
| InChIKey | RGFYDCGFXPEUBM-RQJHMYQMSA-N |
| XLogP | 1.59 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.69 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-chloro-3-methyl-2-[(2R,6S)-2-methyl-6-(trifluoromethyl)morpholin-4-yl]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-3-methyl-2-[(2R,6S)-2-methyl-6-(trifluoromethyl)morpholin-4-yl]pyrimidin-4-one?
The IUPAC name of 6-chloro-3-methyl-2-[(2R,6S)-2-methyl-6-(trifluoromethyl)morpholin-4-yl]pyrimidin-4-one (CID 176666613) is 6-chloro-3-methyl-2-[(2R,6S)-2-methyl-6-(trifluoromethyl)morpholin-4-yl]pyrimidin-4-one.
What is the SMILES notation for 6-chloro-3-methyl-2-[(2R,6S)-2-methyl-6-(trifluoromethyl)morpholin-4-yl]pyrimidin-4-one?
The canonical SMILES for 6-chloro-3-methyl-2-[(2R,6S)-2-methyl-6-(trifluoromethyl)morpholin-4-yl]pyrimidin-4-one is C[C@@H]1CN(c2nc(Cl)cc(=O)n2C)C[C@@H](C(F)(F)F)O1.
What is the InChIKey of 6-chloro-3-methyl-2-[(2R,6S)-2-methyl-6-(trifluoromethyl)morpholin-4-yl]pyrimidin-4-one?
The InChIKey is RGFYDCGFXPEUBM-RQJHMYQMSA-N. The full InChI is InChI=1S/C11H13ClF3N3O2/c1-6-4-18(5-7(20-6)11(13,14)15)10-16-8(12)3-9(19)17(10)2/h3,6-7H,4-5H2,1-2H3/t6-,7+/m1/s1.
What are the key properties of 6-chloro-3-methyl-2-[(2R,6S)-2-methyl-6-(trifluoromethyl)morpholin-4-yl]pyrimidin-4-one?
6-chloro-3-methyl-2-[(2R,6S)-2-methyl-6-(trifluoromethyl)morpholin-4-yl]pyrimidin-4-one has a molecular weight of 311.69 g/mol, XLogP of 1.59, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-3-methyl-2-[(2R,6S)-2-methyl-6-(trifluoromethyl)morpholin-4-yl]pyrimidin-4-one is sourced from PubChem (CID 176666613), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).