About [(3R,5S)-3,5-dimethylpiperidin-4-yl]methanol
[(3R,5S)-3,5-dimethylpiperidin-4-yl]methanol (PubChem CID 176666690) has the molecular formula C8H17NO
and a molecular weight of 143.23 g/mol. Its IUPAC name is [(3R,5S)-3,5-dimethylpiperidin-4-yl]methanol.
Molecular Properties
| Compound Name | [(3R,5S)-3,5-dimethylpiperidin-4-yl]methanol |
| PubChem CID | 176666690 |
| Molecular Formula | C8H17NO |
| Molecular Weight | 143.23 g/mol |
| Exact Mass | 143.13 |
| IUPAC Name | [(3R,5S)-3,5-dimethylpiperidin-4-yl]methanol |
| SMILES | C[C@@H]1CNC[C@H](C)C1CO |
| InChI | InChI=1S/C8H17NO/c1-6-3-9-4-7(2)8(6)5-10/h6-10H,3-5H2,1-2H3/t6-,7+,8? |
| InChIKey | RQPCZZRABRDHKI-DHBOJHSNSA-N |
| XLogP | 0.47 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.23 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [(3R,5S)-3,5-dimethylpiperidin-4-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3R,5S)-3,5-dimethylpiperidin-4-yl]methanol?
The IUPAC name of [(3R,5S)-3,5-dimethylpiperidin-4-yl]methanol (CID 176666690) is [(3R,5S)-3,5-dimethylpiperidin-4-yl]methanol.
What is the SMILES notation for [(3R,5S)-3,5-dimethylpiperidin-4-yl]methanol?
The canonical SMILES for [(3R,5S)-3,5-dimethylpiperidin-4-yl]methanol is C[C@@H]1CNC[C@H](C)C1CO.
What is the InChIKey of [(3R,5S)-3,5-dimethylpiperidin-4-yl]methanol?
The InChIKey is RQPCZZRABRDHKI-DHBOJHSNSA-N. The full InChI is InChI=1S/C8H17NO/c1-6-3-9-4-7(2)8(6)5-10/h6-10H,3-5H2,1-2H3/t6-,7+,8?.
What are the key properties of [(3R,5S)-3,5-dimethylpiperidin-4-yl]methanol?
[(3R,5S)-3,5-dimethylpiperidin-4-yl]methanol has a molecular weight of 143.23 g/mol, XLogP of 0.47, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(3R,5S)-3,5-dimethylpiperidin-4-yl]methanol is sourced from PubChem (CID 176666690), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).