About 2-[(2S,6R)-2,6-dimethyloxan-4-yl]oxy-5-ethyl-4-methylpyridine
2-[(2S,6R)-2,6-dimethyloxan-4-yl]oxy-5-ethyl-4-methylpyridine (PubChem CID 176666936) has the molecular formula C15H23NO2
and a molecular weight of 249.35 g/mol. Its IUPAC name is 2-[(2S,6R)-2,6-dimethyloxan-4-yl]oxy-5-ethyl-4-methylpyridine.
Molecular Properties
| Compound Name | 2-[(2S,6R)-2,6-dimethyloxan-4-yl]oxy-5-ethyl-4-methylpyridine |
| PubChem CID | 176666936 |
| Molecular Formula | C15H23NO2 |
| Molecular Weight | 249.35 g/mol |
| Exact Mass | 249.17 |
| IUPAC Name | 2-[(2S,6R)-2,6-dimethyloxan-4-yl]oxy-5-ethyl-4-methylpyridine |
| SMILES | CCc1cnc(OC2C[C@@H](C)O[C@@H](C)C2)cc1C |
| InChI | InChI=1S/C15H23NO2/c1-5-13-9-16-15(6-10(13)2)18-14-7-11(3)17-12(4)8-14/h6,9,11-12,14H,5,7-8H2,1-4H3/t11-,12+,14? |
| InChIKey | OANGWRXWNZYQQW-ONXXMXGDSA-N |
| XLogP | 3.29 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.35 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[(2S,6R)-2,6-dimethyloxan-4-yl]oxy-5-ethyl-4-methylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2S,6R)-2,6-dimethyloxan-4-yl]oxy-5-ethyl-4-methylpyridine?
The IUPAC name of 2-[(2S,6R)-2,6-dimethyloxan-4-yl]oxy-5-ethyl-4-methylpyridine (CID 176666936) is 2-[(2S,6R)-2,6-dimethyloxan-4-yl]oxy-5-ethyl-4-methylpyridine.
What is the SMILES notation for 2-[(2S,6R)-2,6-dimethyloxan-4-yl]oxy-5-ethyl-4-methylpyridine?
The canonical SMILES for 2-[(2S,6R)-2,6-dimethyloxan-4-yl]oxy-5-ethyl-4-methylpyridine is CCc1cnc(OC2C[C@@H](C)O[C@@H](C)C2)cc1C.
What is the InChIKey of 2-[(2S,6R)-2,6-dimethyloxan-4-yl]oxy-5-ethyl-4-methylpyridine?
The InChIKey is OANGWRXWNZYQQW-ONXXMXGDSA-N. The full InChI is InChI=1S/C15H23NO2/c1-5-13-9-16-15(6-10(13)2)18-14-7-11(3)17-12(4)8-14/h6,9,11-12,14H,5,7-8H2,1-4H3/t11-,12+,14?.
What are the key properties of 2-[(2S,6R)-2,6-dimethyloxan-4-yl]oxy-5-ethyl-4-methylpyridine?
2-[(2S,6R)-2,6-dimethyloxan-4-yl]oxy-5-ethyl-4-methylpyridine has a molecular weight of 249.35 g/mol, XLogP of 3.29, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2S,6R)-2,6-dimethyloxan-4-yl]oxy-5-ethyl-4-methylpyridine is sourced from PubChem (CID 176666936), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).