About 1-(azetidin-1-yl)-5-methylisoquinoline;N,N-diethyl-5-propan-2-ylnaphthalen-1-amine
1-(azetidin-1-yl)-5-methylisoquinoline;N,N-diethyl-5-propan-2-ylnaphthalen-1-amine (PubChem CID 176667976) has the molecular formula C30H37N3
and a molecular weight of 439.65 g/mol. Its IUPAC name is 1-(azetidin-1-yl)-5-methylisoquinoline;N,N-diethyl-5-propan-2-ylnaphthalen-1-amine.
Molecular Properties
| Compound Name | 1-(azetidin-1-yl)-5-methylisoquinoline;N,N-diethyl-5-propan-2-ylnaphthalen-1-amine |
| PubChem CID | 176667976 |
| Molecular Formula | C30H37N3 |
| Molecular Weight | 439.65 g/mol |
| Exact Mass | 439.30 |
| IUPAC Name | 1-(azetidin-1-yl)-5-methylisoquinoline;N,N-diethyl-5-propan-2-ylnaphthalen-1-amine |
| SMILES | CCN(CC)c1cccc2c(C(C)C)cccc12.Cc1cccc2c(N3CCC3)nccc12 |
| InChI | InChI=1S/C17H23N.C13H14N2/c1-5-18(6-2)17-12-8-10-15-14(13(3)4)9-7-11-16(15)17;1-10-4-2-5-12-11(10)6-7-14-13(12)15-8-3-9-15/h7-13H,5-6H2,1-4H3;2,4-7H,3,8-9H2,1H3 |
| InChIKey | LELUZVXUHVDHHC-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 439.65 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(azetidin-1-yl)-5-methylisoquinoline;N,N-diethyl-5-propan-2-ylnaphthalen-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(azetidin-1-yl)-5-methylisoquinoline;N,N-diethyl-5-propan-2-ylnaphthalen-1-amine?
The IUPAC name of 1-(azetidin-1-yl)-5-methylisoquinoline;N,N-diethyl-5-propan-2-ylnaphthalen-1-amine (CID 176667976) is 1-(azetidin-1-yl)-5-methylisoquinoline;N,N-diethyl-5-propan-2-ylnaphthalen-1-amine.
What is the SMILES notation for 1-(azetidin-1-yl)-5-methylisoquinoline;N,N-diethyl-5-propan-2-ylnaphthalen-1-amine?
The canonical SMILES for 1-(azetidin-1-yl)-5-methylisoquinoline;N,N-diethyl-5-propan-2-ylnaphthalen-1-amine is CCN(CC)c1cccc2c(C(C)C)cccc12.Cc1cccc2c(N3CCC3)nccc12.
What is the InChIKey of 1-(azetidin-1-yl)-5-methylisoquinoline;N,N-diethyl-5-propan-2-ylnaphthalen-1-amine?
The InChIKey is LELUZVXUHVDHHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H23N.C13H14N2/c1-5-18(6-2)17-12-8-10-15-14(13(3)4)9-7-11-16(15)17;1-10-4-2-5-12-11(10)6-7-14-13(12)15-8-3-9-15/h7-13H,5-6H2,1-4H3;2,4-7H,3,8-9H2,1H3.
What are the key properties of 1-(azetidin-1-yl)-5-methylisoquinoline;N,N-diethyl-5-propan-2-ylnaphthalen-1-amine?
1-(azetidin-1-yl)-5-methylisoquinoline;N,N-diethyl-5-propan-2-ylnaphthalen-1-amine has a molecular weight of 439.65 g/mol, XLogP of 7.56, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(azetidin-1-yl)-5-methylisoquinoline;N,N-diethyl-5-propan-2-ylnaphthalen-1-amine is sourced from PubChem (CID 176667976), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).