C16H17F2N3O3S — CID 176668007
5-(3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-ylsulfonyl)-1-(difluoromethoxy)isoquinoline (PubChem CID 176668007) has the molecular formula C16H17F2N3O3S and a molecular weight of 369.39 g/mol. Its IUPAC name is 5-(3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-ylsulfonyl)-1-(difluoromethoxy)isoquinoline.
| Compound Name | 5-(3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-ylsulfonyl)-1-(difluoromethoxy)isoquinoline |
|---|---|
| PubChem CID | 176668007 |
| Molecular Formula | C16H17F2N3O3S |
| Molecular Weight | 369.39 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | 5-(3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-ylsulfonyl)-1-(difluoromethoxy)isoquinoline |
| SMILES | O=S(=O)(c1cccc2c(OC(F)F)nccc12)N1CCC2CNCC21 |
| InChI | InChI=1S/C16H17F2N3O3S/c17-16(18)24-15-12-2-1-3-14(11(12)4-6-20-15)25(22,23)21-7-5-10-8-19-9-13(10)21/h1-4,6,10,13,16,19H,5,7-9H2 |
| InChIKey | HUVMKWNFRSWLGM-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.39 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |