C27H34N6O2 — CID 176668391
2-but-3-en-2-yl-N-[1-cyclohexyl-2-[4-(3,5-dimethyl-1H-pyrazol-4-yl)anilino]-2-oxoethyl]pyrazole-3-carboxamide (PubChem CID 176668391) has the molecular formula C27H34N6O2 and a molecular weight of 474.61 g/mol. Its IUPAC name is 2-but-3-en-2-yl-N-[1-cyclohexyl-2-[4-(3,5-dimethyl-1H-pyrazol-4-yl)anilino]-2-oxoethyl]pyrazole-3-carboxamide.
| Compound Name | 2-but-3-en-2-yl-N-[1-cyclohexyl-2-[4-(3,5-dimethyl-1H-pyrazol-4-yl)anilino]-2-oxoethyl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 176668391 |
| Molecular Formula | C27H34N6O2 |
| Molecular Weight | 474.61 g/mol |
| Exact Mass | 474.27 |
| IUPAC Name | 2-but-3-en-2-yl-N-[1-cyclohexyl-2-[4-(3,5-dimethyl-1H-pyrazol-4-yl)anilino]-2-oxoethyl]pyrazole-3-carboxamide |
| SMILES | C=CC(C)n1nccc1C(=O)NC(C(=O)Nc1ccc(-c2c(C)n[nH]c2C)cc1)C1CCCCC1 |
| InChI | InChI=1S/C27H34N6O2/c1-5-17(2)33-23(15-16-28-33)26(34)30-25(21-9-7-6-8-10-21)27(35)29-22-13-11-20(12-14-22)24-18(3)31-32-19(24)4/h5,11-17,21,25H,1,6-10H2,2-4H3,(H,29,35)(H,30,34)(H,31,32) |
| InChIKey | QYKPVSNJRGRZHP-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 104.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.61 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|