C43H62AlN5O7S — CID 176668586
CID 176668586 (PubChem CID 176668586) has the molecular formula C43H62AlN5O7S and a molecular weight of 820.05 g/mol.
| Compound Name | CID 176668586 |
|---|---|
| PubChem CID | 176668586 |
| Molecular Formula | C43H62AlN5O7S |
| Molecular Weight | 820.05 g/mol |
| Exact Mass | 819.42 |
| IUPAC Name | — |
| SMILES | CC.CSc1cc(C)[nH]c(=O)c1CNC(=O)c1cc(-c2ccc(N3CC(C)OC(C)C3)nc2)c2c(c1C)OC(C)(C1CCC(NC(=O)OC(C)(C)C)CC1)O2.C[Al] |
| InChI | InChI=1S/C40H53N5O7S.C2H6.CH3.Al/c1-22-16-32(53-9)31(37(47)43-22)19-42-36(46)29-17-30(26-10-15-33(41-18-26)45-20-23(2)49-24(3)21-45)35-34(25(29)4)50-40(8,51-35)27-11-13-28(14-12-27)44-38(48)52-39(5,6)7;1-2;;/h10,15-18,23-24,27-28H,11-14,19-21H2,1-9H3,(H,42,46)(H,43,47)(H,44,48);1-2H3;1H3; |
| InChIKey | VGXOSCPWFIVCKN-UHFFFAOYSA-N |
| XLogP | 8.12 |
| TPSA | 144.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 820.05 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |