C42H30F3N3O2 — CID 176668724
5-[4-(3,5-dimethoxyphenyl)-2-[4-(trifluoromethyl)phenyl]quinolin-8-yl]-10-phenylphenazine (PubChem CID 176668724) has the molecular formula C42H30F3N3O2 and a molecular weight of 665.72 g/mol. Its IUPAC name is 5-[4-(3,5-dimethoxyphenyl)-2-[4-(trifluoromethyl)phenyl]quinolin-8-yl]-10-phenylphenazine.
| Compound Name | 5-[4-(3,5-dimethoxyphenyl)-2-[4-(trifluoromethyl)phenyl]quinolin-8-yl]-10-phenylphenazine |
|---|---|
| PubChem CID | 176668724 |
| Molecular Formula | C42H30F3N3O2 |
| Molecular Weight | 665.72 g/mol |
| Exact Mass | 665.23 |
| IUPAC Name | 5-[4-(3,5-dimethoxyphenyl)-2-[4-(trifluoromethyl)phenyl]quinolin-8-yl]-10-phenylphenazine |
| SMILES | COc1cc(OC)cc(-c2cc(-c3ccc(C(F)(F)F)cc3)nc3c(N4c5ccccc5N(c5ccccc5)c5ccccc54)cccc23)c1 |
| InChI | InChI=1S/C42H30F3N3O2/c1-49-31-23-28(24-32(25-31)50-2)34-26-35(27-19-21-29(22-20-27)42(43,44)45)46-41-33(34)13-10-18-40(41)48-38-16-8-6-14-36(38)47(30-11-4-3-5-12-30)37-15-7-9-17-39(37)48/h3-26H,1-2H3 |
| InChIKey | ZYYBHVHUSJJPFM-UHFFFAOYSA-N |
| XLogP | 11.86 |
| TPSA | 37.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.72 |
| LogP ≤ 5 | 11.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |