C36H25F3N2O3 — CID 176668885
10-[4-(3,4-dimethoxyphenyl)-2-[4-(trifluoromethyl)phenyl]quinolin-8-yl]phenoxazine (PubChem CID 176668885) has the molecular formula C36H25F3N2O3 and a molecular weight of 590.60 g/mol. Its IUPAC name is 10-[4-(3,4-dimethoxyphenyl)-2-[4-(trifluoromethyl)phenyl]quinolin-8-yl]phenoxazine.
| Compound Name | 10-[4-(3,4-dimethoxyphenyl)-2-[4-(trifluoromethyl)phenyl]quinolin-8-yl]phenoxazine |
|---|---|
| PubChem CID | 176668885 |
| Molecular Formula | C36H25F3N2O3 |
| Molecular Weight | 590.60 g/mol |
| Exact Mass | 590.18 |
| IUPAC Name | 10-[4-(3,4-dimethoxyphenyl)-2-[4-(trifluoromethyl)phenyl]quinolin-8-yl]phenoxazine |
| SMILES | COc1ccc(-c2cc(-c3ccc(C(F)(F)F)cc3)nc3c(N4c5ccccc5Oc5ccccc54)cccc23)cc1OC |
| InChI | InChI=1S/C36H25F3N2O3/c1-42-33-19-16-23(20-34(33)43-2)26-21-27(22-14-17-24(18-15-22)36(37,38)39)40-35-25(26)8-7-11-30(35)41-28-9-3-5-12-31(28)44-32-13-6-4-10-29(32)41/h3-21H,1-2H3 |
| InChIKey | ZTKLLZKKLSKLIZ-UHFFFAOYSA-N |
| XLogP | 10.18 |
| TPSA | 43.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.60 |
| LogP ≤ 5 | 10.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |