C36H27FN2O2Se — CID 176668928
10-[4-(3,5-dimethoxyphenyl)-2-(4-fluorophenyl)-5-methylquinolin-8-yl]phenoselenazine (PubChem CID 176668928) has the molecular formula C36H27FN2O2Se and a molecular weight of 617.58 g/mol. Its IUPAC name is 10-[4-(3,5-dimethoxyphenyl)-2-(4-fluorophenyl)-5-methylquinolin-8-yl]phenoselenazine.
| Compound Name | 10-[4-(3,5-dimethoxyphenyl)-2-(4-fluorophenyl)-5-methylquinolin-8-yl]phenoselenazine |
|---|---|
| PubChem CID | 176668928 |
| Molecular Formula | C36H27FN2O2Se |
| Molecular Weight | 617.58 g/mol |
| Exact Mass | 618.12 |
| IUPAC Name | 10-[4-(3,5-dimethoxyphenyl)-2-(4-fluorophenyl)-5-methylquinolin-8-yl]phenoselenazine |
| SMILES | COc1cc(OC)cc(-c2cc(-c3ccc(F)cc3)nc3c(N4c5ccccc5[Se]c5ccccc54)ccc(C)c23)c1 |
| InChI | InChI=1S/C36H27FN2O2Se/c1-22-12-17-32(39-30-8-4-6-10-33(30)42-34-11-7-5-9-31(34)39)36-35(22)28(24-18-26(40-2)20-27(19-24)41-3)21-29(38-36)23-13-15-25(37)16-14-23/h4-21H,1-3H3 |
| InChIKey | KWXKAACRRCGREE-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.58 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|