C38H31FN2O — CID 176669047
10-[4-(4-tert-butylphenyl)-2-(4-fluorophenyl)-5-methylquinolin-8-yl]phenoxazine (PubChem CID 176669047) has the molecular formula C38H31FN2O and a molecular weight of 550.68 g/mol. Its IUPAC name is 10-[4-(4-tert-butylphenyl)-2-(4-fluorophenyl)-5-methylquinolin-8-yl]phenoxazine.
| Compound Name | 10-[4-(4-tert-butylphenyl)-2-(4-fluorophenyl)-5-methylquinolin-8-yl]phenoxazine |
|---|---|
| PubChem CID | 176669047 |
| Molecular Formula | C38H31FN2O |
| Molecular Weight | 550.68 g/mol |
| Exact Mass | 550.24 |
| IUPAC Name | 10-[4-(4-tert-butylphenyl)-2-(4-fluorophenyl)-5-methylquinolin-8-yl]phenoxazine |
| SMILES | Cc1ccc(N2c3ccccc3Oc3ccccc32)c2nc(-c3ccc(F)cc3)cc(-c3ccc(C(C)(C)C)cc3)c12 |
| InChI | InChI=1S/C38H31FN2O/c1-24-13-22-33(41-31-9-5-7-11-34(31)42-35-12-8-6-10-32(35)41)37-36(24)29(25-14-18-27(19-15-25)38(2,3)4)23-30(40-37)26-16-20-28(39)21-17-26/h5-23H,1-4H3 |
| InChIKey | FINQHUUMKKPJBF-UHFFFAOYSA-N |
| XLogP | 10.89 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.68 |
| LogP ≤ 5 | 10.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |