About 2-chloro-4-methylpyrrolo[2,3-d][1,3]thiazole-5,6-dicarbaldehyde
2-chloro-4-methylpyrrolo[2,3-d][1,3]thiazole-5,6-dicarbaldehyde (PubChem CID 176669708) has the molecular formula C8H5ClN2O2S
and a molecular weight of 228.66 g/mol. Its IUPAC name is 2-chloro-4-methylpyrrolo[2,3-d][1,3]thiazole-5,6-dicarbaldehyde.
Molecular Properties
| Compound Name | 2-chloro-4-methylpyrrolo[2,3-d][1,3]thiazole-5,6-dicarbaldehyde |
| PubChem CID | 176669708 |
| Molecular Formula | C8H5ClN2O2S |
| Molecular Weight | 228.66 g/mol |
| Exact Mass | 227.98 |
| IUPAC Name | 2-chloro-4-methylpyrrolo[2,3-d][1,3]thiazole-5,6-dicarbaldehyde |
| SMILES | Cn1c(C=O)c(C=O)c2sc(Cl)nc21 |
| InChI | InChI=1S/C8H5ClN2O2S/c1-11-5(3-13)4(2-12)6-7(11)10-8(9)14-6/h2-3H,1H3 |
| InChIKey | YRDQSLVENVQONF-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.66 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-4-methylpyrrolo[2,3-d][1,3]thiazole-5,6-dicarbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-4-methylpyrrolo[2,3-d][1,3]thiazole-5,6-dicarbaldehyde?
The IUPAC name of 2-chloro-4-methylpyrrolo[2,3-d][1,3]thiazole-5,6-dicarbaldehyde (CID 176669708) is 2-chloro-4-methylpyrrolo[2,3-d][1,3]thiazole-5,6-dicarbaldehyde.
What is the SMILES notation for 2-chloro-4-methylpyrrolo[2,3-d][1,3]thiazole-5,6-dicarbaldehyde?
The canonical SMILES for 2-chloro-4-methylpyrrolo[2,3-d][1,3]thiazole-5,6-dicarbaldehyde is Cn1c(C=O)c(C=O)c2sc(Cl)nc21.
What is the InChIKey of 2-chloro-4-methylpyrrolo[2,3-d][1,3]thiazole-5,6-dicarbaldehyde?
The InChIKey is YRDQSLVENVQONF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5ClN2O2S/c1-11-5(3-13)4(2-12)6-7(11)10-8(9)14-6/h2-3H,1H3.
What are the key properties of 2-chloro-4-methylpyrrolo[2,3-d][1,3]thiazole-5,6-dicarbaldehyde?
2-chloro-4-methylpyrrolo[2,3-d][1,3]thiazole-5,6-dicarbaldehyde has a molecular weight of 228.66 g/mol, XLogP of 1.91, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-4-methylpyrrolo[2,3-d][1,3]thiazole-5,6-dicarbaldehyde is sourced from PubChem (CID 176669708), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).