C14H19F2N3O2 — CID 176670499
3-[(3S)-4,4-difluorooxolan-3-yl]-1-methyl-1-(1-pyridin-4-ylpropyl)urea (PubChem CID 176670499) has the molecular formula C14H19F2N3O2 and a molecular weight of 299.32 g/mol. Its IUPAC name is 3-[(3S)-4,4-difluorooxolan-3-yl]-1-methyl-1-(1-pyridin-4-ylpropyl)urea.
| Compound Name | 3-[(3S)-4,4-difluorooxolan-3-yl]-1-methyl-1-(1-pyridin-4-ylpropyl)urea |
|---|---|
| PubChem CID | 176670499 |
| Molecular Formula | C14H19F2N3O2 |
| Molecular Weight | 299.32 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | 3-[(3S)-4,4-difluorooxolan-3-yl]-1-methyl-1-(1-pyridin-4-ylpropyl)urea |
| SMILES | CCC(c1ccncc1)N(C)C(=O)N[C@H]1COCC1(F)F |
| InChI | InChI=1S/C14H19F2N3O2/c1-3-11(10-4-6-17-7-5-10)19(2)13(20)18-12-8-21-9-14(12,15)16/h4-7,11-12H,3,8-9H2,1-2H3,(H,18,20)/t11?,12-/m0/s1 |
| InChIKey | IWPDGCIWIASHHM-KIYNQFGBSA-N |
| XLogP | 2.21 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.32 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |