About 2-amino-N-(3-amino-3-methyl-2-oxobutyl)-N-methylacetamide;but-1-ene
2-amino-N-(3-amino-3-methyl-2-oxobutyl)-N-methylacetamide;but-1-ene (PubChem CID 176672047) has the molecular formula C12H25N3O2
and a molecular weight of 243.35 g/mol. Its IUPAC name is 2-amino-N-(3-amino-3-methyl-2-oxobutyl)-N-methylacetamide;but-1-ene.
Molecular Properties
| Compound Name | 2-amino-N-(3-amino-3-methyl-2-oxobutyl)-N-methylacetamide;but-1-ene |
| PubChem CID | 176672047 |
| Molecular Formula | C12H25N3O2 |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.19 |
| IUPAC Name | 2-amino-N-(3-amino-3-methyl-2-oxobutyl)-N-methylacetamide;but-1-ene |
| SMILES | C=CCC.CN(CC(=O)C(C)(C)N)C(=O)CN |
| InChI | InChI=1S/C8H17N3O2.C4H8/c1-8(2,10)6(12)5-11(3)7(13)4-9;1-3-4-2/h4-5,9-10H2,1-3H3;3H,1,4H2,2H3 |
| InChIKey | QUFOTRTYNFJKBD-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 89.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-N-(3-amino-3-methyl-2-oxobutyl)-N-methylacetamide;but-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-N-(3-amino-3-methyl-2-oxobutyl)-N-methylacetamide;but-1-ene?
The IUPAC name of 2-amino-N-(3-amino-3-methyl-2-oxobutyl)-N-methylacetamide;but-1-ene (CID 176672047) is 2-amino-N-(3-amino-3-methyl-2-oxobutyl)-N-methylacetamide;but-1-ene.
What is the SMILES notation for 2-amino-N-(3-amino-3-methyl-2-oxobutyl)-N-methylacetamide;but-1-ene?
The canonical SMILES for 2-amino-N-(3-amino-3-methyl-2-oxobutyl)-N-methylacetamide;but-1-ene is C=CCC.CN(CC(=O)C(C)(C)N)C(=O)CN.
What is the InChIKey of 2-amino-N-(3-amino-3-methyl-2-oxobutyl)-N-methylacetamide;but-1-ene?
The InChIKey is QUFOTRTYNFJKBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17N3O2.C4H8/c1-8(2,10)6(12)5-11(3)7(13)4-9;1-3-4-2/h4-5,9-10H2,1-3H3;3H,1,4H2,2H3.
What are the key properties of 2-amino-N-(3-amino-3-methyl-2-oxobutyl)-N-methylacetamide;but-1-ene?
2-amino-N-(3-amino-3-methyl-2-oxobutyl)-N-methylacetamide;but-1-ene has a molecular weight of 243.35 g/mol, XLogP of 0.29, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-N-(3-amino-3-methyl-2-oxobutyl)-N-methylacetamide;but-1-ene is sourced from PubChem (CID 176672047), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).