About 2-(2-aminoacetyl)oxypropyl 2-acetyloxy-2-(4-acetyloxyphenyl)acetate;propane
2-(2-aminoacetyl)oxypropyl 2-acetyloxy-2-(4-acetyloxyphenyl)acetate;propane (PubChem CID 176672876) has the molecular formula C20H29NO8
and a molecular weight of 411.45 g/mol. Its IUPAC name is 2-(2-aminoacetyl)oxypropyl 2-acetyloxy-2-(4-acetyloxyphenyl)acetate;propane.
Molecular Properties
| Compound Name | 2-(2-aminoacetyl)oxypropyl 2-acetyloxy-2-(4-acetyloxyphenyl)acetate;propane |
| PubChem CID | 176672876 |
| Molecular Formula | C20H29NO8 |
| Molecular Weight | 411.45 g/mol |
| Exact Mass | 411.19 |
| IUPAC Name | 2-(2-aminoacetyl)oxypropyl 2-acetyloxy-2-(4-acetyloxyphenyl)acetate;propane |
| SMILES | CC(=O)Oc1ccc(C(OC(C)=O)C(=O)OCC(C)OC(=O)CN)cc1.CCC |
| InChI | InChI=1S/C17H21NO8.C3H8/c1-10(24-15(21)8-18)9-23-17(22)16(26-12(3)20)13-4-6-14(7-5-13)25-11(2)19;1-3-2/h4-7,10,16H,8-9,18H2,1-3H3;3H2,1-2H3 |
| InChIKey | OGLJAVIMGIYIJL-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 131.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 411.45 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-aminoacetyl)oxypropyl 2-acetyloxy-2-(4-acetyloxyphenyl)acetate;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-aminoacetyl)oxypropyl 2-acetyloxy-2-(4-acetyloxyphenyl)acetate;propane?
The IUPAC name of 2-(2-aminoacetyl)oxypropyl 2-acetyloxy-2-(4-acetyloxyphenyl)acetate;propane (CID 176672876) is 2-(2-aminoacetyl)oxypropyl 2-acetyloxy-2-(4-acetyloxyphenyl)acetate;propane.
What is the SMILES notation for 2-(2-aminoacetyl)oxypropyl 2-acetyloxy-2-(4-acetyloxyphenyl)acetate;propane?
The canonical SMILES for 2-(2-aminoacetyl)oxypropyl 2-acetyloxy-2-(4-acetyloxyphenyl)acetate;propane is CC(=O)Oc1ccc(C(OC(C)=O)C(=O)OCC(C)OC(=O)CN)cc1.CCC.
What is the InChIKey of 2-(2-aminoacetyl)oxypropyl 2-acetyloxy-2-(4-acetyloxyphenyl)acetate;propane?
The InChIKey is OGLJAVIMGIYIJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21NO8.C3H8/c1-10(24-15(21)8-18)9-23-17(22)16(26-12(3)20)13-4-6-14(7-5-13)25-11(2)19;1-3-2/h4-7,10,16H,8-9,18H2,1-3H3;3H2,1-2H3.
What are the key properties of 2-(2-aminoacetyl)oxypropyl 2-acetyloxy-2-(4-acetyloxyphenyl)acetate;propane?
2-(2-aminoacetyl)oxypropyl 2-acetyloxy-2-(4-acetyloxyphenyl)acetate;propane has a molecular weight of 411.45 g/mol, XLogP of 2.07, 8 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-aminoacetyl)oxypropyl 2-acetyloxy-2-(4-acetyloxyphenyl)acetate;propane is sourced from PubChem (CID 176672876), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).