C9H17N3 — CID 176673035
N-ethyl-N-(1H-imidazol-2-ylmethyl)propan-2-amine (PubChem CID 176673035) has the molecular formula C9H17N3 and a molecular weight of 167.26 g/mol. Its IUPAC name is N-ethyl-N-(1H-imidazol-2-ylmethyl)propan-2-amine.
| Compound Name | N-ethyl-N-(1H-imidazol-2-ylmethyl)propan-2-amine |
|---|---|
| PubChem CID | 176673035 |
| Molecular Formula | C9H17N3 |
| Molecular Weight | 167.26 g/mol |
| Exact Mass | 167.14 |
| IUPAC Name | N-ethyl-N-(1H-imidazol-2-ylmethyl)propan-2-amine |
| SMILES | CCN(Cc1ncc[nH]1)C(C)C |
| InChI | InChI=1S/C9H17N3/c1-4-12(8(2)3)7-9-10-5-6-11-9/h5-6,8H,4,7H2,1-3H3,(H,10,11) |
| InChIKey | MUCNPRNUDUQXNV-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.26 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |