About 2-methyl-4-propan-2-yl-[1,3]thiazolo[5,4-c]pyridine
2-methyl-4-propan-2-yl-[1,3]thiazolo[5,4-c]pyridine (PubChem CID 176673227) has the molecular formula C10H12N2S
and a molecular weight of 192.29 g/mol. Its IUPAC name is 2-methyl-4-propan-2-yl-[1,3]thiazolo[5,4-c]pyridine.
Molecular Properties
| Compound Name | 2-methyl-4-propan-2-yl-[1,3]thiazolo[5,4-c]pyridine |
| PubChem CID | 176673227 |
| Molecular Formula | C10H12N2S |
| Molecular Weight | 192.29 g/mol |
| Exact Mass | 192.07 |
| IUPAC Name | 2-methyl-4-propan-2-yl-[1,3]thiazolo[5,4-c]pyridine |
| SMILES | Cc1nc2ccnc(C(C)C)c2s1 |
| InChI | InChI=1S/C10H12N2S/c1-6(2)9-10-8(4-5-11-9)12-7(3)13-10/h4-6H,1-3H3 |
| InChIKey | ZQEJLBXQZGFXQN-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.29 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methyl-4-propan-2-yl-[1,3]thiazolo[5,4-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-4-propan-2-yl-[1,3]thiazolo[5,4-c]pyridine?
The IUPAC name of 2-methyl-4-propan-2-yl-[1,3]thiazolo[5,4-c]pyridine (CID 176673227) is 2-methyl-4-propan-2-yl-[1,3]thiazolo[5,4-c]pyridine.
What is the SMILES notation for 2-methyl-4-propan-2-yl-[1,3]thiazolo[5,4-c]pyridine?
The canonical SMILES for 2-methyl-4-propan-2-yl-[1,3]thiazolo[5,4-c]pyridine is Cc1nc2ccnc(C(C)C)c2s1.
What is the InChIKey of 2-methyl-4-propan-2-yl-[1,3]thiazolo[5,4-c]pyridine?
The InChIKey is ZQEJLBXQZGFXQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2S/c1-6(2)9-10-8(4-5-11-9)12-7(3)13-10/h4-6H,1-3H3.
What are the key properties of 2-methyl-4-propan-2-yl-[1,3]thiazolo[5,4-c]pyridine?
2-methyl-4-propan-2-yl-[1,3]thiazolo[5,4-c]pyridine has a molecular weight of 192.29 g/mol, XLogP of 3.12, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-4-propan-2-yl-[1,3]thiazolo[5,4-c]pyridine is sourced from PubChem (CID 176673227), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).