About 5-[2-fluoro-6-hydroxy-3-(2-pyrazin-2-ylethynyl)phenyl]-1-oxo-1,2,5-thiadiazolidin-3-one
5-[2-fluoro-6-hydroxy-3-(2-pyrazin-2-ylethynyl)phenyl]-1-oxo-1,2,5-thiadiazolidin-3-one (PubChem CID 176675171) has the molecular formula C14H9FN4O3S
and a molecular weight of 332.32 g/mol. Its IUPAC name is 5-[2-fluoro-6-hydroxy-3-(2-pyrazin-2-ylethynyl)phenyl]-1-oxo-1,2,5-thiadiazolidin-3-one.
Molecular Properties
| Compound Name | 5-[2-fluoro-6-hydroxy-3-(2-pyrazin-2-ylethynyl)phenyl]-1-oxo-1,2,5-thiadiazolidin-3-one |
| PubChem CID | 176675171 |
| Molecular Formula | C14H9FN4O3S |
| Molecular Weight | 332.32 g/mol |
| Exact Mass | 332.04 |
| IUPAC Name | 5-[2-fluoro-6-hydroxy-3-(2-pyrazin-2-ylethynyl)phenyl]-1-oxo-1,2,5-thiadiazolidin-3-one |
| SMILES | O=C1CN(c2c(O)ccc(C#Cc3cnccn3)c2F)S(=O)N1 |
| InChI | InChI=1S/C14H9FN4O3S/c15-13-9(1-3-10-7-16-5-6-17-10)2-4-11(20)14(13)19-8-12(21)18-23(19)22/h2,4-7,20H,8H2,(H,18,21) |
| InChIKey | APCYHGDPTDVFIN-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 95.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.32 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-[2-fluoro-6-hydroxy-3-(2-pyrazin-2-ylethynyl)phenyl]-1-oxo-1,2,5-thiadiazolidin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[2-fluoro-6-hydroxy-3-(2-pyrazin-2-ylethynyl)phenyl]-1-oxo-1,2,5-thiadiazolidin-3-one?
The IUPAC name of 5-[2-fluoro-6-hydroxy-3-(2-pyrazin-2-ylethynyl)phenyl]-1-oxo-1,2,5-thiadiazolidin-3-one (CID 176675171) is 5-[2-fluoro-6-hydroxy-3-(2-pyrazin-2-ylethynyl)phenyl]-1-oxo-1,2,5-thiadiazolidin-3-one.
What is the SMILES notation for 5-[2-fluoro-6-hydroxy-3-(2-pyrazin-2-ylethynyl)phenyl]-1-oxo-1,2,5-thiadiazolidin-3-one?
The canonical SMILES for 5-[2-fluoro-6-hydroxy-3-(2-pyrazin-2-ylethynyl)phenyl]-1-oxo-1,2,5-thiadiazolidin-3-one is O=C1CN(c2c(O)ccc(C#Cc3cnccn3)c2F)S(=O)N1.
What is the InChIKey of 5-[2-fluoro-6-hydroxy-3-(2-pyrazin-2-ylethynyl)phenyl]-1-oxo-1,2,5-thiadiazolidin-3-one?
The InChIKey is APCYHGDPTDVFIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9FN4O3S/c15-13-9(1-3-10-7-16-5-6-17-10)2-4-11(20)14(13)19-8-12(21)18-23(19)22/h2,4-7,20H,8H2,(H,18,21).
What are the key properties of 5-[2-fluoro-6-hydroxy-3-(2-pyrazin-2-ylethynyl)phenyl]-1-oxo-1,2,5-thiadiazolidin-3-one?
5-[2-fluoro-6-hydroxy-3-(2-pyrazin-2-ylethynyl)phenyl]-1-oxo-1,2,5-thiadiazolidin-3-one has a molecular weight of 332.32 g/mol, XLogP of 0.24, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[2-fluoro-6-hydroxy-3-(2-pyrazin-2-ylethynyl)phenyl]-1-oxo-1,2,5-thiadiazolidin-3-one is sourced from PubChem (CID 176675171), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).