About N-[(Z)-(2,4-dichloropyrimidin-5-yl)methylideneamino]-2,4-difluoroaniline
N-[(Z)-(2,4-dichloropyrimidin-5-yl)methylideneamino]-2,4-difluoroaniline (PubChem CID 176675526) has the molecular formula C11H6Cl2F2N4
and a molecular weight of 303.10 g/mol. Its IUPAC name is N-[(Z)-(2,4-dichloropyrimidin-5-yl)methylideneamino]-2,4-difluoroaniline.
Molecular Properties
| Compound Name | N-[(Z)-(2,4-dichloropyrimidin-5-yl)methylideneamino]-2,4-difluoroaniline |
| PubChem CID | 176675526 |
| Molecular Formula | C11H6Cl2F2N4 |
| Molecular Weight | 303.10 g/mol |
| Exact Mass | 301.99 |
| IUPAC Name | N-[(Z)-(2,4-dichloropyrimidin-5-yl)methylideneamino]-2,4-difluoroaniline |
| SMILES | Fc1ccc(N/N=C\c2cnc(Cl)nc2Cl)c(F)c1 |
| InChI | InChI=1S/C11H6Cl2F2N4/c12-10-6(4-16-11(13)18-10)5-17-19-9-2-1-7(14)3-8(9)15/h1-5,19H/b17-5- |
| InChIKey | NLGIZMCXWGQNFQ-ZWSORDCHSA-N |
| XLogP | 3.51 |
| TPSA | 50.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.10 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[(Z)-(2,4-dichloropyrimidin-5-yl)methylideneamino]-2,4-difluoroaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(Z)-(2,4-dichloropyrimidin-5-yl)methylideneamino]-2,4-difluoroaniline?
The IUPAC name of N-[(Z)-(2,4-dichloropyrimidin-5-yl)methylideneamino]-2,4-difluoroaniline (CID 176675526) is N-[(Z)-(2,4-dichloropyrimidin-5-yl)methylideneamino]-2,4-difluoroaniline.
What is the SMILES notation for N-[(Z)-(2,4-dichloropyrimidin-5-yl)methylideneamino]-2,4-difluoroaniline?
The canonical SMILES for N-[(Z)-(2,4-dichloropyrimidin-5-yl)methylideneamino]-2,4-difluoroaniline is Fc1ccc(N/N=C\c2cnc(Cl)nc2Cl)c(F)c1.
What is the InChIKey of N-[(Z)-(2,4-dichloropyrimidin-5-yl)methylideneamino]-2,4-difluoroaniline?
The InChIKey is NLGIZMCXWGQNFQ-ZWSORDCHSA-N. The full InChI is InChI=1S/C11H6Cl2F2N4/c12-10-6(4-16-11(13)18-10)5-17-19-9-2-1-7(14)3-8(9)15/h1-5,19H/b17-5-.
What are the key properties of N-[(Z)-(2,4-dichloropyrimidin-5-yl)methylideneamino]-2,4-difluoroaniline?
N-[(Z)-(2,4-dichloropyrimidin-5-yl)methylideneamino]-2,4-difluoroaniline has a molecular weight of 303.10 g/mol, XLogP of 3.51, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(Z)-(2,4-dichloropyrimidin-5-yl)methylideneamino]-2,4-difluoroaniline is sourced from PubChem (CID 176675526), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).