About 6-[4-(aminomethyl)phenyl]-2-azaspiro[3.3]heptane-2-carbaldehyde;2-methylpropan-2-ol
6-[4-(aminomethyl)phenyl]-2-azaspiro[3.3]heptane-2-carbaldehyde;2-methylpropan-2-ol (PubChem CID 176675556) has the molecular formula C18H28N2O2
and a molecular weight of 304.43 g/mol. Its IUPAC name is 6-[4-(aminomethyl)phenyl]-2-azaspiro[3.3]heptane-2-carbaldehyde;2-methylpropan-2-ol.
Molecular Properties
| Compound Name | 6-[4-(aminomethyl)phenyl]-2-azaspiro[3.3]heptane-2-carbaldehyde;2-methylpropan-2-ol |
| PubChem CID | 176675556 |
| Molecular Formula | C18H28N2O2 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.22 |
| IUPAC Name | 6-[4-(aminomethyl)phenyl]-2-azaspiro[3.3]heptane-2-carbaldehyde;2-methylpropan-2-ol |
| SMILES | CC(C)(C)O.NCc1ccc(C2CC3(C2)CN(C=O)C3)cc1 |
| InChI | InChI=1S/C14H18N2O.C4H10O/c15-7-11-1-3-12(4-2-11)13-5-14(6-13)8-16(9-14)10-17;1-4(2,3)5/h1-4,10,13H,5-9,15H2;5H,1-3H3 |
| InChIKey | ODTYYZVFFLLGSS-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 6-[4-(aminomethyl)phenyl]-2-azaspiro[3.3]heptane-2-carbaldehyde;2-methylpropan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[4-(aminomethyl)phenyl]-2-azaspiro[3.3]heptane-2-carbaldehyde;2-methylpropan-2-ol?
The IUPAC name of 6-[4-(aminomethyl)phenyl]-2-azaspiro[3.3]heptane-2-carbaldehyde;2-methylpropan-2-ol (CID 176675556) is 6-[4-(aminomethyl)phenyl]-2-azaspiro[3.3]heptane-2-carbaldehyde;2-methylpropan-2-ol.
What is the SMILES notation for 6-[4-(aminomethyl)phenyl]-2-azaspiro[3.3]heptane-2-carbaldehyde;2-methylpropan-2-ol?
The canonical SMILES for 6-[4-(aminomethyl)phenyl]-2-azaspiro[3.3]heptane-2-carbaldehyde;2-methylpropan-2-ol is CC(C)(C)O.NCc1ccc(C2CC3(C2)CN(C=O)C3)cc1.
What is the InChIKey of 6-[4-(aminomethyl)phenyl]-2-azaspiro[3.3]heptane-2-carbaldehyde;2-methylpropan-2-ol?
The InChIKey is ODTYYZVFFLLGSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18N2O.C4H10O/c15-7-11-1-3-12(4-2-11)13-5-14(6-13)8-16(9-14)10-17;1-4(2,3)5/h1-4,10,13H,5-9,15H2;5H,1-3H3.
What are the key properties of 6-[4-(aminomethyl)phenyl]-2-azaspiro[3.3]heptane-2-carbaldehyde;2-methylpropan-2-ol?
6-[4-(aminomethyl)phenyl]-2-azaspiro[3.3]heptane-2-carbaldehyde;2-methylpropan-2-ol has a molecular weight of 304.43 g/mol, XLogP of 2.26, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[4-(aminomethyl)phenyl]-2-azaspiro[3.3]heptane-2-carbaldehyde;2-methylpropan-2-ol is sourced from PubChem (CID 176675556), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).