C14H28N4 — CID 176675649
N',3-dimethyl-2-[(1-methylazetidin-3-yl)iminomethyl]-N'-propylbut-1-ene-1,4-diamine (PubChem CID 176675649) has the molecular formula C14H28N4 and a molecular weight of 252.41 g/mol. Its IUPAC name is N',3-dimethyl-2-[(1-methylazetidin-3-yl)iminomethyl]-N'-propylbut-1-ene-1,4-diamine.
| Compound Name | N',3-dimethyl-2-[(1-methylazetidin-3-yl)iminomethyl]-N'-propylbut-1-ene-1,4-diamine |
|---|---|
| PubChem CID | 176675649 |
| Molecular Formula | C14H28N4 |
| Molecular Weight | 252.41 g/mol |
| Exact Mass | 252.23 |
| IUPAC Name | N',3-dimethyl-2-[(1-methylazetidin-3-yl)iminomethyl]-N'-propylbut-1-ene-1,4-diamine |
| SMILES | CCCN(C)CC(C)C(=CN)/C=N/C1CN(C)C1 |
| InChI | InChI=1S/C14H28N4/c1-5-6-17(3)9-12(2)13(7-15)8-16-14-10-18(4)11-14/h7-8,12,14H,5-6,9-11,15H2,1-4H3/b13-7?,16-8+ |
| InChIKey | QQIKXKMEURVSPH-GVTZZKNWSA-N |
| XLogP | 1.19 |
| TPSA | 44.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.41 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|