C18H22Cl2LiN3O2-2 — CID 176675828
lithium;(2S)-1-(3-aminopyrrolidin-1-yl)-2-methanidylbutan-1-one;(4,5-dichloro-3a,7a-dihydro-1H-indol-2-yl)methanone (PubChem CID 176675828) has the molecular formula C18H22Cl2LiN3O2-2 and a molecular weight of 390.24 g/mol. Its IUPAC name is lithium;(2S)-1-(3-aminopyrrolidin-1-yl)-2-methanidylbutan-1-one;(4,5-dichloro-3a,7a-dihydro-1H-indol-2-yl)methanone.
| Compound Name | lithium;(2S)-1-(3-aminopyrrolidin-1-yl)-2-methanidylbutan-1-one;(4,5-dichloro-3a,7a-dihydro-1H-indol-2-yl)methanone |
|---|---|
| PubChem CID | 176675828 |
| Molecular Formula | C18H22Cl2LiN3O2-2 |
| Molecular Weight | 390.24 g/mol |
| Exact Mass | 389.13 |
| IUPAC Name | lithium;(2S)-1-(3-aminopyrrolidin-1-yl)-2-methanidylbutan-1-one;(4,5-dichloro-3a,7a-dihydro-1H-indol-2-yl)methanone |
| SMILES | O=[C-]C1=CC2C(Cl)=C(Cl)C=CC2N1.[CH2-]C[C@H]([CH2-])C(=O)N1CCC(N)C1.[Li+] |
| InChI | InChI=1S/C9H6Cl2NO.C9H16N2O.Li/c10-7-1-2-8-6(9(7)11)3-5(4-13)12-8;1-3-7(2)9(12)11-5-4-8(10)6-11;/h1-3,6,8,12H;7-8H,1-6,10H2;/q-1;-2;+1/t;7-,8?;/m.0./s1 |
| InChIKey | HUJQLLQHHQEPKM-FYFBANBJSA-N |
| XLogP | -0.95 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.24 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|