C21H19F3N6O2 — CID 176676635
3-[1-methyl-5-[(1-oxo-3,4-dihydro-2H-isoquinolin-6-yl)amino]-1,2,4-triazol-3-yl]-N-(2,2,2-trifluoroethyl)benzamide (PubChem CID 176676635) has the molecular formula C21H19F3N6O2 and a molecular weight of 444.42 g/mol. Its IUPAC name is 3-[1-methyl-5-[(1-oxo-3,4-dihydro-2H-isoquinolin-6-yl)amino]-1,2,4-triazol-3-yl]-N-(2,2,2-trifluoroethyl)benzamide.
| Compound Name | 3-[1-methyl-5-[(1-oxo-3,4-dihydro-2H-isoquinolin-6-yl)amino]-1,2,4-triazol-3-yl]-N-(2,2,2-trifluoroethyl)benzamide |
|---|---|
| PubChem CID | 176676635 |
| Molecular Formula | C21H19F3N6O2 |
| Molecular Weight | 444.42 g/mol |
| Exact Mass | 444.15 |
| IUPAC Name | 3-[1-methyl-5-[(1-oxo-3,4-dihydro-2H-isoquinolin-6-yl)amino]-1,2,4-triazol-3-yl]-N-(2,2,2-trifluoroethyl)benzamide |
| SMILES | Cn1nc(-c2cccc(C(=O)NCC(F)(F)F)c2)nc1Nc1ccc2c(c1)CCNC2=O |
| InChI | InChI=1S/C21H19F3N6O2/c1-30-20(27-15-5-6-16-12(10-15)7-8-25-19(16)32)28-17(29-30)13-3-2-4-14(9-13)18(31)26-11-21(22,23)24/h2-6,9-10H,7-8,11H2,1H3,(H,25,32)(H,26,31)(H,27,28,29) |
| InChIKey | QQMJJQTXTSGPRB-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 100.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.42 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |