About 2-[(1,3-difluoropropan-2-ylamino)methyl]pentane-1-thiol
2-[(1,3-difluoropropan-2-ylamino)methyl]pentane-1-thiol (PubChem CID 176676719) has the molecular formula C9H19F2NS
and a molecular weight of 211.32 g/mol. Its IUPAC name is 2-[(1,3-difluoropropan-2-ylamino)methyl]pentane-1-thiol.
Molecular Properties
| Compound Name | 2-[(1,3-difluoropropan-2-ylamino)methyl]pentane-1-thiol |
| PubChem CID | 176676719 |
| Molecular Formula | C9H19F2NS |
| Molecular Weight | 211.32 g/mol |
| Exact Mass | 211.12 |
| IUPAC Name | 2-[(1,3-difluoropropan-2-ylamino)methyl]pentane-1-thiol |
| SMILES | CCCC(CS)CNC(CF)CF |
| InChI | InChI=1S/C9H19F2NS/c1-2-3-8(7-13)6-12-9(4-10)5-11/h8-9,12-13H,2-7H2,1H3 |
| InChIKey | SNSXWOGSSKXJLA-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.32 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[(1,3-difluoropropan-2-ylamino)methyl]pentane-1-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1,3-difluoropropan-2-ylamino)methyl]pentane-1-thiol?
The IUPAC name of 2-[(1,3-difluoropropan-2-ylamino)methyl]pentane-1-thiol (CID 176676719) is 2-[(1,3-difluoropropan-2-ylamino)methyl]pentane-1-thiol.
What is the SMILES notation for 2-[(1,3-difluoropropan-2-ylamino)methyl]pentane-1-thiol?
The canonical SMILES for 2-[(1,3-difluoropropan-2-ylamino)methyl]pentane-1-thiol is CCCC(CS)CNC(CF)CF.
What is the InChIKey of 2-[(1,3-difluoropropan-2-ylamino)methyl]pentane-1-thiol?
The InChIKey is SNSXWOGSSKXJLA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19F2NS/c1-2-3-8(7-13)6-12-9(4-10)5-11/h8-9,12-13H,2-7H2,1H3.
What are the key properties of 2-[(1,3-difluoropropan-2-ylamino)methyl]pentane-1-thiol?
2-[(1,3-difluoropropan-2-ylamino)methyl]pentane-1-thiol has a molecular weight of 211.32 g/mol, XLogP of 2.23, 8 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1,3-difluoropropan-2-ylamino)methyl]pentane-1-thiol is sourced from PubChem (CID 176676719), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).