C21H39N4+ — CID 176676731
N-(4,4-dimethylpent-1-en-2-yl)-N'-[3-(1H-imidazol-3-ium-3-yl)prop-1-en-2-yl]octane-1,8-diamine (PubChem CID 176676731) has the molecular formula C21H39N4+ and a molecular weight of 347.57 g/mol. Its IUPAC name is N-(4,4-dimethylpent-1-en-2-yl)-N'-[3-(1H-imidazol-3-ium-3-yl)prop-1-en-2-yl]octane-1,8-diamine.
| Compound Name | N-(4,4-dimethylpent-1-en-2-yl)-N'-[3-(1H-imidazol-3-ium-3-yl)prop-1-en-2-yl]octane-1,8-diamine |
|---|---|
| PubChem CID | 176676731 |
| Molecular Formula | C21H39N4+ |
| Molecular Weight | 347.57 g/mol |
| Exact Mass | 347.32 |
| IUPAC Name | N-(4,4-dimethylpent-1-en-2-yl)-N'-[3-(1H-imidazol-3-ium-3-yl)prop-1-en-2-yl]octane-1,8-diamine |
| SMILES | C=C(C[n+]1cc[nH]c1)NCCCCCCCCNC(=C)CC(C)(C)C |
| InChI | InChI=1S/C21H38N4/c1-19(16-21(3,4)5)23-12-10-8-6-7-9-11-13-24-20(2)17-25-15-14-22-18-25/h14-15,18,23-24H,1-2,6-13,16-17H2,3-5H3/p+1 |
| InChIKey | QZASSVZMASDSAM-UHFFFAOYSA-O |
| XLogP | 4.29 |
| TPSA | 43.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.57 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|