C12H11ClN4O — CID 176676954
6-(6-chloro-2-pyridinyl)-N,2-dimethylpyrimidine-4-carboxamide (PubChem CID 176676954) has the molecular formula C12H11ClN4O and a molecular weight of 262.70 g/mol. Its IUPAC name is 6-(6-chloro-2-pyridinyl)-N,2-dimethylpyrimidine-4-carboxamide.
| Compound Name | 6-(6-chloro-2-pyridinyl)-N,2-dimethylpyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 176676954 |
| Molecular Formula | C12H11ClN4O |
| Molecular Weight | 262.70 g/mol |
| Exact Mass | 262.06 |
| IUPAC Name | 6-(6-chloro-2-pyridinyl)-N,2-dimethylpyrimidine-4-carboxamide |
| SMILES | CNC(=O)c1cc(-c2cccc(Cl)n2)nc(C)n1 |
| InChI | InChI=1S/C12H11ClN4O/c1-7-15-9(6-10(16-7)12(18)14-2)8-4-3-5-11(13)17-8/h3-6H,1-2H3,(H,14,18) |
| InChIKey | COXFMGRWQSWDTB-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.70 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|