C20H33NO5S — CID 176677310
butane;[2,5-dioxo-3-(2-oxopropylsulfanyl)pyrrolidin-1-yl] 4-ethylcyclohexane-1-carboxylate (PubChem CID 176677310) has the molecular formula C20H33NO5S and a molecular weight of 399.55 g/mol. Its IUPAC name is butane;[2,5-dioxo-3-(2-oxopropylsulfanyl)pyrrolidin-1-yl] 4-ethylcyclohexane-1-carboxylate.
| Compound Name | butane;[2,5-dioxo-3-(2-oxopropylsulfanyl)pyrrolidin-1-yl] 4-ethylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 176677310 |
| Molecular Formula | C20H33NO5S |
| Molecular Weight | 399.55 g/mol |
| Exact Mass | 399.21 |
| IUPAC Name | butane;[2,5-dioxo-3-(2-oxopropylsulfanyl)pyrrolidin-1-yl] 4-ethylcyclohexane-1-carboxylate |
| SMILES | CCC1CCC(C(=O)ON2C(=O)CC(SCC(C)=O)C2=O)CC1.CCCC |
| InChI | InChI=1S/C16H23NO5S.C4H10/c1-3-11-4-6-12(7-5-11)16(21)22-17-14(19)8-13(15(17)20)23-9-10(2)18;1-3-4-2/h11-13H,3-9H2,1-2H3;3-4H2,1-2H3 |
| InChIKey | YGBIWWLDPNSAMK-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.55 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|