C23H24F2N6O3 — CID 176677777
N-[3,3-difluoro-5-[1-[5-(methylamino)-3-pyridinyl]pyrrolo[2,3-b]pyridin-5-yl]pentyl]formamide;1,2-oxazole-5-carbaldehyde (PubChem CID 176677777) has the molecular formula C23H24F2N6O3 and a molecular weight of 470.48 g/mol. Its IUPAC name is N-[3,3-difluoro-5-[1-[5-(methylamino)-3-pyridinyl]pyrrolo[2,3-b]pyridin-5-yl]pentyl]formamide;1,2-oxazole-5-carbaldehyde.
| Compound Name | N-[3,3-difluoro-5-[1-[5-(methylamino)-3-pyridinyl]pyrrolo[2,3-b]pyridin-5-yl]pentyl]formamide;1,2-oxazole-5-carbaldehyde |
|---|---|
| PubChem CID | 176677777 |
| Molecular Formula | C23H24F2N6O3 |
| Molecular Weight | 470.48 g/mol |
| Exact Mass | 470.19 |
| IUPAC Name | N-[3,3-difluoro-5-[1-[5-(methylamino)-3-pyridinyl]pyrrolo[2,3-b]pyridin-5-yl]pentyl]formamide;1,2-oxazole-5-carbaldehyde |
| SMILES | CNc1cncc(-n2ccc3cc(CCC(F)(F)CCNC=O)cnc32)c1.O=Cc1ccno1 |
| InChI | InChI=1S/C19H21F2N5O.C4H3NO2/c1-22-16-9-17(12-24-11-16)26-7-3-15-8-14(10-25-18(15)26)2-4-19(20,21)5-6-23-13-27;6-3-4-1-2-5-7-4/h3,7-13,22H,2,4-6H2,1H3,(H,23,27);1-3H |
| InChIKey | CLZLVPLEVGLCJG-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 114.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.48 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|