About 6-chloro-1'-methyl-2-methylidenespiro[1,4-dihydroquinoline-3,4'-piperidine];ethane
6-chloro-1'-methyl-2-methylidenespiro[1,4-dihydroquinoline-3,4'-piperidine];ethane (PubChem CID 176678034) has the molecular formula C17H25ClN2
and a molecular weight of 292.85 g/mol. Its IUPAC name is 6-chloro-1'-methyl-2-methylidenespiro[1,4-dihydroquinoline-3,4'-piperidine];ethane.
Molecular Properties
| Compound Name | 6-chloro-1'-methyl-2-methylidenespiro[1,4-dihydroquinoline-3,4'-piperidine];ethane |
| PubChem CID | 176678034 |
| Molecular Formula | C17H25ClN2 |
| Molecular Weight | 292.85 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | 6-chloro-1'-methyl-2-methylidenespiro[1,4-dihydroquinoline-3,4'-piperidine];ethane |
| SMILES | C=C1Nc2ccc(Cl)cc2CC12CCN(C)CC2.CC |
| InChI | InChI=1S/C15H19ClN2.C2H6/c1-11-15(5-7-18(2)8-6-15)10-12-9-13(16)3-4-14(12)17-11;1-2/h3-4,9,17H,1,5-8,10H2,2H3;1-2H3 |
| InChIKey | LDNQTZZBOATQIP-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.85 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-chloro-1'-methyl-2-methylidenespiro[1,4-dihydroquinoline-3,4'-piperidine];ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-1'-methyl-2-methylidenespiro[1,4-dihydroquinoline-3,4'-piperidine];ethane?
The IUPAC name of 6-chloro-1'-methyl-2-methylidenespiro[1,4-dihydroquinoline-3,4'-piperidine];ethane (CID 176678034) is 6-chloro-1'-methyl-2-methylidenespiro[1,4-dihydroquinoline-3,4'-piperidine];ethane.
What is the SMILES notation for 6-chloro-1'-methyl-2-methylidenespiro[1,4-dihydroquinoline-3,4'-piperidine];ethane?
The canonical SMILES for 6-chloro-1'-methyl-2-methylidenespiro[1,4-dihydroquinoline-3,4'-piperidine];ethane is C=C1Nc2ccc(Cl)cc2CC12CCN(C)CC2.CC.
What is the InChIKey of 6-chloro-1'-methyl-2-methylidenespiro[1,4-dihydroquinoline-3,4'-piperidine];ethane?
The InChIKey is LDNQTZZBOATQIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19ClN2.C2H6/c1-11-15(5-7-18(2)8-6-15)10-12-9-13(16)3-4-14(12)17-11;1-2/h3-4,9,17H,1,5-8,10H2,2H3;1-2H3.
What are the key properties of 6-chloro-1'-methyl-2-methylidenespiro[1,4-dihydroquinoline-3,4'-piperidine];ethane?
6-chloro-1'-methyl-2-methylidenespiro[1,4-dihydroquinoline-3,4'-piperidine];ethane has a molecular weight of 292.85 g/mol, XLogP of 4.56, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-1'-methyl-2-methylidenespiro[1,4-dihydroquinoline-3,4'-piperidine];ethane is sourced from PubChem (CID 176678034), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).