C17H28N2O2 — CID 176678113
ethane;1'-methylspiro[1H-3,1-benzoxazine-4,4'-piperidine]-2-one (PubChem CID 176678113) has the molecular formula C17H28N2O2 and a molecular weight of 292.42 g/mol. Its IUPAC name is ethane;1'-methylspiro[1H-3,1-benzoxazine-4,4'-piperidine]-2-one.
| Compound Name | ethane;1'-methylspiro[1H-3,1-benzoxazine-4,4'-piperidine]-2-one |
|---|---|
| PubChem CID | 176678113 |
| Molecular Formula | C17H28N2O2 |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.22 |
| IUPAC Name | ethane;1'-methylspiro[1H-3,1-benzoxazine-4,4'-piperidine]-2-one |
| SMILES | CC.CC.CN1CCC2(CC1)OC(=O)Nc1ccccc12 |
| InChI | InChI=1S/C13H16N2O2.2C2H6/c1-15-8-6-13(7-9-15)10-4-2-3-5-11(10)14-12(16)17-13;2*1-2/h2-5H,6-9H2,1H3,(H,14,16);2*1-2H3 |
| InChIKey | YFIXXBPQUNVRBM-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |