About ethane;N-(2-methylprop-1-enyl)-N-propyl-1H-pyrrolo[2,3-b]pyridin-4-amine
ethane;N-(2-methylprop-1-enyl)-N-propyl-1H-pyrrolo[2,3-b]pyridin-4-amine (PubChem CID 176678136) has the molecular formula C18H31N3
and a molecular weight of 289.47 g/mol. Its IUPAC name is ethane;N-(2-methylprop-1-enyl)-N-propyl-1H-pyrrolo[2,3-b]pyridin-4-amine.
Molecular Properties
| Compound Name | ethane;N-(2-methylprop-1-enyl)-N-propyl-1H-pyrrolo[2,3-b]pyridin-4-amine |
| PubChem CID | 176678136 |
| Molecular Formula | C18H31N3 |
| Molecular Weight | 289.47 g/mol |
| Exact Mass | 289.25 |
| IUPAC Name | ethane;N-(2-methylprop-1-enyl)-N-propyl-1H-pyrrolo[2,3-b]pyridin-4-amine |
| SMILES | CC.CC.CCCN(C=C(C)C)c1ccnc2[nH]ccc12 |
| InChI | InChI=1S/C14H19N3.2C2H6/c1-4-9-17(10-11(2)3)13-6-8-16-14-12(13)5-7-15-14;2*1-2/h5-8,10H,4,9H2,1-3H3,(H,15,16);2*1-2H3 |
| InChIKey | KOZJPKMYHJKYRC-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 289.47 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;N-(2-methylprop-1-enyl)-N-propyl-1H-pyrrolo[2,3-b]pyridin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;N-(2-methylprop-1-enyl)-N-propyl-1H-pyrrolo[2,3-b]pyridin-4-amine?
The IUPAC name of ethane;N-(2-methylprop-1-enyl)-N-propyl-1H-pyrrolo[2,3-b]pyridin-4-amine (CID 176678136) is ethane;N-(2-methylprop-1-enyl)-N-propyl-1H-pyrrolo[2,3-b]pyridin-4-amine.
What is the SMILES notation for ethane;N-(2-methylprop-1-enyl)-N-propyl-1H-pyrrolo[2,3-b]pyridin-4-amine?
The canonical SMILES for ethane;N-(2-methylprop-1-enyl)-N-propyl-1H-pyrrolo[2,3-b]pyridin-4-amine is CC.CC.CCCN(C=C(C)C)c1ccnc2[nH]ccc12.
What is the InChIKey of ethane;N-(2-methylprop-1-enyl)-N-propyl-1H-pyrrolo[2,3-b]pyridin-4-amine?
The InChIKey is KOZJPKMYHJKYRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19N3.2C2H6/c1-4-9-17(10-11(2)3)13-6-8-16-14-12(13)5-7-15-14;2*1-2/h5-8,10H,4,9H2,1-3H3,(H,15,16);2*1-2H3.
What are the key properties of ethane;N-(2-methylprop-1-enyl)-N-propyl-1H-pyrrolo[2,3-b]pyridin-4-amine?
ethane;N-(2-methylprop-1-enyl)-N-propyl-1H-pyrrolo[2,3-b]pyridin-4-amine has a molecular weight of 289.47 g/mol, XLogP of 5.76, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;N-(2-methylprop-1-enyl)-N-propyl-1H-pyrrolo[2,3-b]pyridin-4-amine is sourced from PubChem (CID 176678136), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).