C9H16N2OS — CID 176678198
(Z)-N-[(3S)-piperidin-3-yl]-2-sulfanylbut-2-enamide (PubChem CID 176678198) has the molecular formula C9H16N2OS and a molecular weight of 200.31 g/mol. Its IUPAC name is (Z)-N-[(3S)-piperidin-3-yl]-2-sulfanylbut-2-enamide.
| Compound Name | (Z)-N-[(3S)-piperidin-3-yl]-2-sulfanylbut-2-enamide |
|---|---|
| PubChem CID | 176678198 |
| Molecular Formula | C9H16N2OS |
| Molecular Weight | 200.31 g/mol |
| Exact Mass | 200.10 |
| IUPAC Name | (Z)-N-[(3S)-piperidin-3-yl]-2-sulfanylbut-2-enamide |
| SMILES | C/C=C(\S)C(=O)N[C@H]1CCCNC1 |
| InChI | InChI=1S/C9H16N2OS/c1-2-8(13)9(12)11-7-4-3-5-10-6-7/h2,7,10,13H,3-6H2,1H3,(H,11,12)/b8-2-/t7-/m0/s1 |
| InChIKey | MRSNKFXCNRDNFA-CRCMBFRGSA-N |
| XLogP | 0.69 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.31 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|