C23H39NO8 — CID 176680069
ethane;3-methylazetidine-1,3-dicarboxylic acid;(9R,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecane (PubChem CID 176680069) has the molecular formula C23H39NO8 and a molecular weight of 457.56 g/mol. Its IUPAC name is ethane;3-methylazetidine-1,3-dicarboxylic acid;(9R,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecane.
| Compound Name | ethane;3-methylazetidine-1,3-dicarboxylic acid;(9R,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecane |
|---|---|
| PubChem CID | 176680069 |
| Molecular Formula | C23H39NO8 |
| Molecular Weight | 457.56 g/mol |
| Exact Mass | 457.27 |
| IUPAC Name | ethane;3-methylazetidine-1,3-dicarboxylic acid;(9R,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecane |
| SMILES | CC.CC1(C(=O)O)CN(C(=O)O)C1.CC1CCC2[C@@H](C)CO[C@@H]3OC4(C)CCC1[C@@]23OO4 |
| InChI | InChI=1S/C15H24O4.C6H9NO4.C2H6/c1-9-4-5-11-10(2)8-16-13-15(11)12(9)6-7-14(3,17-13)18-19-15;1-6(4(8)9)2-7(3-6)5(10)11;1-2/h9-13H,4-8H2,1-3H3;2-3H2,1H3,(H,8,9)(H,10,11);1-2H3/t9?,10-,11?,12?,13+,14?,15-;;/m0../s1 |
| InChIKey | YREAAWNWLXLHTC-FSSKPJBYSA-N |
| XLogP | 3.97 |
| TPSA | 114.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.56 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|