C40H39F5N4O5 — CID 176680147
[(2Z,4Z)-1,3,4,5,6-pentafluorohepta-2,4,6-trien-2-yl] 4-[[2-[[[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-methylamino]methyl]-1-propylindol-5-yl]amino]-4-oxobutanoate (PubChem CID 176680147) has the molecular formula C40H39F5N4O5 and a molecular weight of 750.76 g/mol. Its IUPAC name is [(2Z,4Z)-1,3,4,5,6-pentafluorohepta-2,4,6-trien-2-yl] 4-[[2-[[[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-methylamino]methyl]-1-propylindol-5-yl]amino]-4-oxobutanoate.
| Compound Name | [(2Z,4Z)-1,3,4,5,6-pentafluorohepta-2,4,6-trien-2-yl] 4-[[2-[[[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-methylamino]methyl]-1-propylindol-5-yl]amino]-4-oxobutanoate |
|---|---|
| PubChem CID | 176680147 |
| Molecular Formula | C40H39F5N4O5 |
| Molecular Weight | 750.76 g/mol |
| Exact Mass | 750.28 |
| IUPAC Name | [(2Z,4Z)-1,3,4,5,6-pentafluorohepta-2,4,6-trien-2-yl] 4-[[2-[[[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-methylamino]methyl]-1-propylindol-5-yl]amino]-4-oxobutanoate |
| SMILES | C=C(F)/C(F)=C(F)\C(F)=C(/CF)OC(=O)CCC(=O)Nc1ccc2c(c1)cc(CN(C)N(C)C(=O)OCC1c3ccccc3-c3ccccc31)n2CCC |
| InChI | InChI=1S/C40H39F5N4O5/c1-5-18-49-27(22-47(3)48(4)40(52)53-23-32-30-12-8-6-10-28(30)29-11-7-9-13-31(29)32)20-25-19-26(14-15-33(25)49)46-35(50)16-17-36(51)54-34(21-41)38(44)39(45)37(43)24(2)42/h6-15,19-20,32H,2,5,16-18,21-23H2,1,3-4H3,(H,46,50)/b38-34-,39-37- |
| InChIKey | BLNGIWBVPLQESW-OVXRFSCTSA-N |
| XLogP | 9.33 |
| TPSA | 93.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 750.76 |
| LogP ≤ 5 | 9.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|